(2R,14aS,15bS)-2,15b-dihydroxy-14a-methyl-1,4,5,12,13,14,14a,15b-octahydro-7H-furo[4',3',2':8,9]phenanthro[3,2-e][1,4]thiazino[2,3,4-hi]indole-7,9(2H)-dione 6,6-dioxide

ID: ALA5287527

Max Phase: Preclinical

Molecular Formula: C24H21NO7S

Molecular Weight: 467.50

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@]12CCCc3coc(c31)C(=O)c1cc3c(cc12)[C@@]1(O)C[C@@H](O)N2CCS(=O)(=O)C(=C21)C3=O

Standard InChI:  InChI=1S/C24H21NO7S/c1-23-4-2-3-11-10-32-20(17(11)23)18(27)12-7-13-15(8-14(12)23)24(29)9-16(26)25-5-6-33(30,31)21(19(13)28)22(24)25/h7-8,10,16,26,29H,2-6,9H2,1H3/t16-,23+,24+/m1/s1

Standard InChI Key:  ONTKLNBZHONWLS-XRJVTAMDSA-N

Molfile:  

 
     RDKit          2D

 33 39  0  0  0  0  0  0  0  0999 V2000
   -3.5074    0.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5074   -0.7284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7900   -1.1394    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0763   -0.7252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0763    0.0997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3645    0.5137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6472    0.1029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6472   -0.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3609   -1.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3609   -1.9616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0681   -1.1331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7816   -0.7189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7816    0.1060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0644    0.5169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4935    0.5201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2089    0.1092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9226    0.5232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9226    1.3483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2053    1.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4935    1.3452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5074   -0.0587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0963   -0.7741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2089   -0.7157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4971   -1.1299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4971   -1.9552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7778    0.9313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7568    1.3080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5819    1.3080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7937    0.5106    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0856    1.9616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9058    1.1998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2034   -1.8555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3781   -1.8555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  7  6  1  0
  8  7  2  0
  9  8  1  0
  4  9  1  0
  9 10  2  0
  8 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
  7 14  1  0
 13 15  1  0
 16 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 15 20  1  0
 17 21  2  0
 21 22  1  0
 23 22  1  0
 16 23  2  0
 24 23  1  0
 12 24  1  0
 24 25  2  0
 15 26  1  1
  6 27  1  0
 27 28  1  0
 29 28  1  0
  1 29  1  0
  5 29  1  0
 28 30  1  6
  6 31  1  1
  3 32  2  0
  3 33  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5287527

    ---

Associated Targets(Human)

USP7 Tchem Ubiquitin carboxyl-terminal hydrolase 7 (837 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 467.50Molecular Weight (Monoisotopic): 467.1039AlogP: 1.51#Rotatable Bonds:
Polar Surface Area: 125.12Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.66CX Basic pKa: CX LogP: 0.70CX LogD: 0.70
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.60Np Likeness Score: 1.49

References

1. Li P, Liu HM..  (2020)  Recent advances in the development of ubiquitin-specific-processing protease 7 (USP7) inhibitors.,  191  [PMID:32092586] [10.1016/j.ejmech.2020.112107]

Source