6-methoxy-N-(pyridin-4-yl)benzo[d]thiazole-2-carboxamide

ID: ALA5287551

Max Phase: Preclinical

Molecular Formula: C14H11N3O2S

Molecular Weight: 285.33

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc2nc(C(=O)Nc3ccncc3)sc2c1

Standard InChI:  InChI=1S/C14H11N3O2S/c1-19-10-2-3-11-12(8-10)20-14(17-11)13(18)16-9-4-6-15-7-5-9/h2-8H,1H3,(H,15,16,18)

Standard InChI Key:  VUEAMDBLDMZWQE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
   -2.8464    0.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1318    0.9369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4199    0.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4199   -0.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1300   -0.7118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8464   -0.3037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5610   -0.7164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5610   -1.5415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6351   -0.5550    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1501    0.1124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6351    0.7799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6749    0.1124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0876    0.8270    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0876   -0.6022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9127    0.8270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3256    1.5415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1483    1.5408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5610    0.8259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1518    0.1140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3271    0.1093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  4  9  1  0
 10  9  1  0
 11 10  2  0
  3 11  1  0
 12 10  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 15 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287551

    ---

Associated Targets(Human)

MAPT Tclin Microtubule-associated protein tau (95507 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 285.33Molecular Weight (Monoisotopic): 285.0572AlogP: 2.95#Rotatable Bonds: 3
Polar Surface Area: 64.11Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.12CX Basic pKa: 5.55CX LogP: 2.21CX LogD: 2.20
Aromatic Rings: 3Heavy Atoms: 20QED Weighted: 0.80Np Likeness Score: -2.14

References

1. Wongso H, Ono M, Yamasaki T, Kumata K, Higuchi M, Zhang MR, Fulham MJ, Katsifis A, Keller PA..  (2023)  Synthesis and structure-activity relationship (SAR) studies of 1,2,3-triazole, amide, and ester-based benzothiazole derivatives as potential molecular probes for tau protein.,  14  (5): [PMID:37252097] [10.1039/d2md00358a]

Source