The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-benzylpiperidin-4-yl)-N-(4-phenylthiazol-2-yl)propionamide ID: ALA5287561
Max Phase: Preclinical
Molecular Formula: C24H27N3OS
Molecular Weight: 405.57
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)N(c1nc(-c2ccccc2)cs1)C1CCN(Cc2ccccc2)CC1
Standard InChI: InChI=1S/C24H27N3OS/c1-2-23(28)27(24-25-22(18-29-24)20-11-7-4-8-12-20)21-13-15-26(16-14-21)17-19-9-5-3-6-10-19/h3-12,18,21H,2,13-17H2,1H3
Standard InChI Key: UMRYFRMGXALPQJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
-1.5255 -0.0586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9380 0.6558 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5255 1.3702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7005 1.3702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2880 0.6558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7005 -0.0586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5367 0.6558 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9491 1.3700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9491 -0.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5367 2.0843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7738 1.3700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2880 2.0843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7738 -0.0583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0238 -0.8621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3705 -1.3327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7033 -0.8408 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.8205 -1.0755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4039 -0.4925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1979 -0.7061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4115 -1.5030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8323 -2.0843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0348 -1.8756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7628 0.6558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1752 -0.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7630 -0.7728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1748 -1.4845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9998 -1.4845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4115 -0.7746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0035 -0.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 1 0
5 7 1 0
7 8 1 0
7 9 1 0
8 10 1 0
8 11 2 0
10 12 1 0
13 9 2 0
13 14 1 0
14 15 2 0
16 15 1 0
9 16 1 0
17 14 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
17 22 1 0
22 21 2 0
2 23 1 0
23 24 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 405.57Molecular Weight (Monoisotopic): 405.1875AlogP: 5.22#Rotatable Bonds: 6Polar Surface Area: 36.44Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.81CX LogP: 4.90CX LogD: 4.35Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.56Np Likeness Score: -1.67
References 1. Zhuang T, Xiong J, Hao S, Du W, Liu Z, Liu B, Zhang G, Chen Y.. (2021) Bifunctional μ opioid and σ1 receptor ligands as novel analgesics with reduced side effects., 223 [PMID:34175542 ] [10.1016/j.ejmech.2021.113658 ]