1-(chloromethyl)-4-(m-tolyl)-[1,2,4]triazolo[4,3-a]quinazolin-5(4H)-one

ID: ALA5287576

Max Phase: Preclinical

Molecular Formula: C17H13ClN4O

Molecular Weight: 324.77

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccc(-n2c(=O)c3ccccc3n3c(CCl)nnc23)c1

Standard InChI:  InChI=1S/C17H13ClN4O/c1-11-5-4-6-12(9-11)21-16(23)13-7-2-3-8-14(13)22-15(10-18)19-20-17(21)22/h2-9H,10H2,1H3

Standard InChI Key:  XFGMROJZDLIFDN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 26  0  0  0  0  0  0  0  0999 V2000
    1.7824    2.9451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7824    2.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4986    1.7075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4986    0.8865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7870    0.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0694    0.8843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0694    1.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3567    0.4718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3567   -0.3489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9784   -0.9160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6524   -1.6520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1715   -1.5647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7549   -2.1482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5414   -2.9451    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.3548   -0.7656    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0724   -0.3515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0724    0.4734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7842    0.8853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4986    0.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4986   -0.3552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7824   -0.7632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3598    0.8843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3598    1.7093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  7  6  2  0
  2  7  1  0
  8  6  1  0
  9  8  1  0
  9 10  2  0
 10 11  1  0
 12 11  2  0
 12 13  1  0
 13 14  1  0
 15 12  1  0
 15  9  1  0
 16 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 17 22  1  0
  8 22  1  0
 22 23  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5287576

    ---

Associated Targets(non-human)

Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 324.77Molecular Weight (Monoisotopic): 324.0778AlogP: 3.08#Rotatable Bonds: 2
Polar Surface Area: 52.19Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.27CX LogD: 3.27
Aromatic Rings: 4Heavy Atoms: 23QED Weighted: 0.53Np Likeness Score: -1.84

References

1. Alagarsamy V, Chitra K, Saravanan G, Solomon VR, Sulthana MT, Narendhar B..  (2018)  An overview of quinazolines: Pharmacological significance and recent developments.,  151  [PMID:29656203] [10.1016/j.ejmech.2018.03.076]

Source