2-((3,5-dichloropyridin-4-yl)thio)-N-(3-methyl-1,1-dioxido-2,3-dihydrobenzo[b]thiophen-6-yl)thiazole-5-carboxamide

ID: ALA5287604

Max Phase: Preclinical

Molecular Formula: C18H13Cl2N3O3S3

Molecular Weight: 486.43

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1CS(=O)(=O)c2cc(NC(=O)c3cnc(Sc4c(Cl)cncc4Cl)s3)ccc21

Standard InChI:  InChI=1S/C18H13Cl2N3O3S3/c1-9-8-29(25,26)15-4-10(2-3-11(9)15)23-17(24)14-7-22-18(27-14)28-16-12(19)5-21-6-13(16)20/h2-7,9H,8H2,1H3,(H,23,24)

Standard InChI Key:  VCNGKTIEBICVJM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    3.2097    2.1341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6210    1.4190    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.0339    2.1341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2445    0.9098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9422    0.1732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1230    0.1732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5442   -0.4079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7472   -0.1993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5329    0.6002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7367    0.8136    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1539    0.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3672   -0.5654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6422    0.4441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2954   -0.0262    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9624    0.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7586    0.2520    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9720   -0.5441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3892   -1.1272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5930   -0.9138    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -2.6027   -1.9207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3991   -2.1341    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9801   -1.5552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7715   -0.7584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3544   -0.1755    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.7167    1.2476    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8922    1.2476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1160    1.1830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9095    0.9696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3544   -0.5755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  2  0
  2  4  1  0
  5  4  1  0
  6  5  1  0
  7  6  1  0
  8  7  2  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
 11 12  2  0
 13 11  1  0
 13 14  1  0
 15 14  1  0
 15 16  1  0
 16 17  1  0
 18 17  2  0
 18 19  1  0
 20 18  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 17 23  1  0
 23 24  1  0
 25 15  2  0
 25 26  1  0
 26 13  2  0
 27  9  2  0
 28 27  1  0
 28  2  1  0
  6 28  2  0
  5 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287604

    ---

Associated Targets(Human)

USP7 Tchem Ubiquitin carboxyl-terminal hydrolase 7 (837 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 486.43Molecular Weight (Monoisotopic): 484.9496AlogP: 5.14#Rotatable Bonds: 4
Polar Surface Area: 89.02Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.72CX Basic pKa: 1.13CX LogP: 4.12CX LogD: 4.12
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.55Np Likeness Score: -1.27

References

1. Li P, Liu HM..  (2020)  Recent advances in the development of ubiquitin-specific-processing protease 7 (USP7) inhibitors.,  191  [PMID:32092586] [10.1016/j.ejmech.2020.112107]

Source