The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-fluoro-5-(((2-(4-(trifluoromethyl)phenyl)thiazol-4-yl)methyl)amino)benzoic acid ID: ALA5287640
Max Phase: Preclinical
Molecular Formula: C18H12F4N2O2S
Molecular Weight: 396.37
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cc(F)cc(NCc2csc(-c3ccc(C(F)(F)F)cc3)n2)c1
Standard InChI: InChI=1S/C18H12F4N2O2S/c19-13-5-11(17(25)26)6-14(7-13)23-8-15-9-27-16(24-15)10-1-3-12(4-2-10)18(20,21)22/h1-7,9,23H,8H2,(H,25,26)
Standard InChI Key: BVRWZQACUALWDO-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
-4.0869 0.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3722 0.9469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6605 0.5350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6605 -0.2901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3706 -0.7018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0869 -0.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9458 0.9476 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2312 0.5350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5165 0.9476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3706 -1.5270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0852 -1.9396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6559 -1.9396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8016 0.9472 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.4304 1.7679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3763 1.9394 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.7887 1.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2368 0.6121 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6138 1.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0268 1.9396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8495 1.9389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2622 1.2241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8530 0.5122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0283 0.5074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0873 1.2241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5000 1.9387 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.0873 0.3973 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.8016 0.8106 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
7 8 1 0
8 9 1 0
10 5 1 0
10 11 1 0
10 12 2 0
1 13 1 0
14 9 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 9 1 0
18 16 1 0
19 18 2 0
20 19 1 0
21 20 2 0
22 21 1 0
18 23 1 0
23 22 2 0
21 24 1 0
24 25 1 0
24 26 1 0
24 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 396.37Molecular Weight (Monoisotopic): 396.0556AlogP: 5.28#Rotatable Bonds: 5Polar Surface Area: 62.22Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.45CX Basic pKa: 2.25CX LogP: 4.61CX LogD: 1.76Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.58Np Likeness Score: -1.88
References 1. Lee JJ, Hu Z, Wang YA, Nath D, Liang W, Cui Y, Ma JX, Duerfeldt AS.. (2023) Design, Synthesis, and Structure-Activity Relationships of Biaryl Anilines as Subtype-Selective PPAR-alpha Agonists., 14 (6): [PMID:37312852 ] [10.1021/acsmedchemlett.3c00056 ]