methyl (Z)-4-(5-((5-oxo-1-(4-sulfamoylphenyl)-3-(trifluoromethyl)-1,5-dihydro-4H-pyrazol-4-ylidene)methyl)furan-2-yl)benzoate

ID: ALA5287689

Max Phase: Preclinical

Molecular Formula: C23H16F3N3O6S

Molecular Weight: 519.46

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1ccc(-c2ccc(/C=C3\C(=O)N(c4ccc(S(N)(=O)=O)cc4)N=C3C(F)(F)F)o2)cc1

Standard InChI:  InChI=1S/C23H16F3N3O6S/c1-34-22(31)14-4-2-13(3-5-14)19-11-8-16(35-19)12-18-20(23(24,25)26)28-29(21(18)30)15-6-9-17(10-7-15)36(27,32)33/h2-12H,1H3,(H2,27,32,33)/b18-12-

Standard InChI Key:  NXEWRJXHTCGJOS-PDGQHHTCSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   -4.2482   -0.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5336    0.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8217   -0.2661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8217   -1.0912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5318   -1.5030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2482   -1.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9628   -1.5075    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5463   -2.0910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7493   -2.3046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6775   -1.0949    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1071    0.1465    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1071    0.9716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3030    1.2218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8321    0.5681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3242   -0.0993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1106   -0.8964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0070    0.5681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4055   -0.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2307   -0.1464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4808   -0.9505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8272   -1.4213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1597   -0.9293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2779   -1.1641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8616   -0.5807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6561   -0.7944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8698   -1.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2903   -2.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4924   -1.9646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6668   -1.8053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2503   -1.2218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8804   -2.6024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6775   -2.8160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0894    2.0189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6729    2.6024    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2923    2.2325    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8758    2.8160    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  2  0
  7  9  2  0
  7 10  1  0
 11  3  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 15 14  1  0
 11 15  1  0
 15 16  2  0
 14 17  2  0
 17 18  1  0
 19 18  1  0
 19 20  1  0
 20 21  2  0
 22 21  1  0
 18 22  2  0
 23 20  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 23 28  1  0
 26 29  1  0
 29 30  2  0
 29 31  1  0
 31 32  1  0
 13 33  1  0
 33 34  1  0
 33 35  1  0
 33 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287689

    ---

Associated Targets(Human)

CLEC4M Tbio C-type lectin domain family 4 member M (115 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 519.46Molecular Weight (Monoisotopic): 519.0712AlogP: 3.73#Rotatable Bonds: 5
Polar Surface Area: 132.27Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.05CX Basic pKa: CX LogP: 3.95CX LogD: 3.95
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -1.37

References

1. Sethi A, Sanam S, Alvala M..  (2021)  Non-carbohydrate strategies to inhibit lectin proteins with special emphasis on galectins.,  222  [PMID:34146913] [10.1016/j.ejmech.2021.113561]

Source