The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl (Z)-4-(5-((5-oxo-1-(4-sulfamoylphenyl)-3-(trifluoromethyl)-1,5-dihydro-4H-pyrazol-4-ylidene)methyl)furan-2-yl)benzoate ID: ALA5287689
Max Phase: Preclinical
Molecular Formula: C23H16F3N3O6S
Molecular Weight: 519.46
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc(-c2ccc(/C=C3\C(=O)N(c4ccc(S(N)(=O)=O)cc4)N=C3C(F)(F)F)o2)cc1
Standard InChI: InChI=1S/C23H16F3N3O6S/c1-34-22(31)14-4-2-13(3-5-14)19-11-8-16(35-19)12-18-20(23(24,25)26)28-29(21(18)30)15-6-9-17(10-7-15)36(27,32)33/h2-12H,1H3,(H2,27,32,33)/b18-12-
Standard InChI Key: NXEWRJXHTCGJOS-PDGQHHTCSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
-4.2482 -0.2664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5336 0.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8217 -0.2661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8217 -1.0912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5318 -1.5030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2482 -1.0949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9628 -1.5075 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.5463 -2.0910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.7493 -2.3046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.6775 -1.0949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1071 0.1465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1071 0.9716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3030 1.2218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8321 0.5681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3242 -0.0993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1106 -0.8964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0070 0.5681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4055 -0.1464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2307 -0.1464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4808 -0.9505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8272 -1.4213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1597 -0.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2779 -1.1641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8616 -0.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6561 -0.7944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8698 -1.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2903 -2.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4924 -1.9646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6668 -1.8053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2503 -1.2218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8804 -2.6024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6775 -2.8160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0894 2.0189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6729 2.6024 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.2923 2.2325 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.8758 2.8160 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 2 0
7 9 2 0
7 10 1 0
11 3 1 0
11 12 1 0
12 13 2 0
13 14 1 0
15 14 1 0
11 15 1 0
15 16 2 0
14 17 2 0
17 18 1 0
19 18 1 0
19 20 1 0
20 21 2 0
22 21 1 0
18 22 2 0
23 20 1 0
24 23 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
23 28 1 0
26 29 1 0
29 30 2 0
29 31 1 0
31 32 1 0
13 33 1 0
33 34 1 0
33 35 1 0
33 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.46Molecular Weight (Monoisotopic): 519.0712AlogP: 3.73#Rotatable Bonds: 5Polar Surface Area: 132.27Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.05CX Basic pKa: ┄CX LogP: 3.95CX LogD: 3.95Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -1.37
References 1. Sethi A, Sanam S, Alvala M.. (2021) Non-carbohydrate strategies to inhibit lectin proteins with special emphasis on galectins., 222 [PMID:34146913 ] [10.1016/j.ejmech.2021.113561 ]