8-(dibenzo[b,d]thiophen-1-yl)-2-morpholino-4H-chromen-4-one

ID: ALA5287725

Max Phase: Preclinical

Molecular Formula: C25H19NO3S

Molecular Weight: 413.50

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1cc(N2CCOCC2)oc2c(-c3cccc4sc5ccccc5c34)cccc12

Standard InChI:  InChI=1S/C25H19NO3S/c27-20-15-23(26-11-13-28-14-12-26)29-25-17(7-3-8-18(20)25)16-6-4-10-22-24(16)19-5-1-2-9-21(19)30-22/h1-10,15H,11-14H2

Standard InChI Key:  LSUVJEUFZJPDTK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 35  0  0  0  0  0  0  0  0999 V2000
   -1.5699   -0.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8553    0.0008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1434   -0.4109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1434   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8536   -1.6480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5699   -1.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5692   -0.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2841   -0.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2859   -1.2337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5743   -1.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5692    0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1453    1.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1446    2.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5702    2.4732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2820    2.0640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2868    1.2393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2846    0.0011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9994   -0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7115    0.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7115    0.8261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0012    1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2846    0.8298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8536   -2.4732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0726    0.9890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0649    2.3234    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5535    1.6590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3715    1.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7115    0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2345    0.1580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4140    0.2345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  2  0
  6  5  1  0
  3  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  4 10  1  0
 11  7  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 11 16  1  0
 16 15  2  0
 17  1  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 21 20  1  0
 17 22  1  0
 22 21  1  0
  5 23  2  0
 16 24  1  0
 15 25  1  0
 25 26  1  0
 26 24  2  0
 26 27  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 24 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287725

    ---

Associated Targets(Human)

BRDT Tchem Bromodomain testis-specific protein (576 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 413.50Molecular Weight (Monoisotopic): 413.1086AlogP: 5.66#Rotatable Bonds: 2
Polar Surface Area: 42.68Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.38CX LogD: 5.38
Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.37Np Likeness Score: -0.57

References

1. Carlino L, Rastelli G..  (2016)  Dual Kinase-Bromodomain Inhibitors in Anticancer Drug Discovery: A Structural and Pharmacological Perspective.,  59  (20): [PMID:27559828] [10.1021/acs.jmedchem.6b00438]

Source