5-[(2-chlorophenyl)methylene]thiazolidine-2,4-dione

ID: ALA5287746

Max Phase: Preclinical

Molecular Formula: C10H6ClNO2S

Molecular Weight: 239.68

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1NC(=O)/C(=C/c2ccccc2Cl)S1

Standard InChI:  InChI=1S/C10H6ClNO2S/c11-7-4-2-1-3-6(7)5-8-9(13)12-10(14)15-8/h1-5H,(H,12,13,14)/b8-5-

Standard InChI Key:  LODOBCLAGUEESL-YVMONPNESA-N

Molfile:  

 
     RDKit          2D

 15 16  0  0  0  0  0  0  0  0999 V2000
   -0.3384    0.2451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0059    0.7301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7510    1.5148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0740    1.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3289    0.7301    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3384   -0.5799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3760   -0.9925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4865    2.2294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8029    0.5165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0909   -0.5800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8029   -0.9921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8029   -1.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0927   -2.2294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3760   -1.8212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0909    0.2450    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  1  6  2  0
  6  7  1  0
  4  8  2  0
  2  9  2  0
 10  7  2  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
  7 14  1  0
 10 15  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287746

    ---

Associated Targets(Human)

Colon cell line (12 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 239.68Molecular Weight (Monoisotopic): 238.9808AlogP: 2.66#Rotatable Bonds: 1
Polar Surface Area: 46.17Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 6.35CX Basic pKa: CX LogP: 2.45CX LogD: 1.42
Aromatic Rings: 1Heavy Atoms: 15QED Weighted: 0.77Np Likeness Score: -1.80

References

1. Sharma PC, Bansal KK, Sharma A, Sharma D, Deep A..  (2020)  Thiazole-containing compounds as therapeutic targets for cancer therapy.,  188  [PMID:31926469] [10.1016/j.ejmech.2019.112016]

Source