5-hydroxy-7-methoxy-2-[4-(4-methylpiperazin-1-yl)phenyl]-8-piperazin-1-yl-chromen-4-one

ID: ALA5287796

Max Phase: Preclinical

Molecular Formula: C25H30N4O4

Molecular Weight: 450.54

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)c2c(=O)cc(-c3ccc(N4CCN(C)CC4)cc3)oc2c1N1CCNCC1

Standard InChI:  InChI=1S/C25H30N4O4/c1-27-11-13-28(14-12-27)18-5-3-17(4-6-18)21-15-19(30)23-20(31)16-22(32-2)24(25(23)33-21)29-9-7-26-8-10-29/h3-6,15-16,26,31H,7-14H2,1-2H3

Standard InChI Key:  FXIMIJCGTDGDFQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   -1.7913   -0.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7913   -1.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0705   -1.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0705   -2.4751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3538   -1.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3538   -0.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0705   -0.0002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3585   -0.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4954   -1.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4954   -2.4751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2165   -1.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2165   -0.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4954   -0.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4954    0.8247    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9287   -0.0002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3577    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0700    1.2366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7853    0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7880    0.0037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0767   -0.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5000    1.2373    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2101    1.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2100    2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4954    2.4751    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7808    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7808    1.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6439   -0.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5000    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2146    2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9292    2.0625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9292    1.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2146    0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6439    2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  3  1  0
  5  6  2  0
  6  7  1  0
  7  1  1  0
  8  6  1  0
  9  2  1  0
 10  9  1  0
  9 11  2  0
 11 12  1  0
 13  1  1  0
 12 13  2  0
 14 13  1  0
 15 12  1  0
 16  8  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
  8 20  1  0
 21 18  1  0
 22 14  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
 26 25  1  0
 14 26  1  0
 15 27  1  0
 28 21  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 32 31  1  0
 21 32  1  0
 30 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287796

    ---

Associated Targets(Human)

CDK9 Tchem Cyclin-dependent kinase 9 (2495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK2 Tchem Cyclin-dependent kinase 2 (9050 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.54Molecular Weight (Monoisotopic): 450.2267AlogP: 2.34#Rotatable Bonds: 4
Polar Surface Area: 81.42Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.20CX Basic pKa: 8.88CX LogP: 1.71CX LogD: 0.84
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.63Np Likeness Score: 0.07

References

1. Huang Z, Wang T, Wang C, Fan Y..  (2022)  CDK9 inhibitors in cancer research.,  13  (6.0): [PMID:35814933] [10.1039/d2md00040g]

Source