5-(pyrazin-2-ylmethyl)imidazo[1,5-a]quinoxalin-4(5H)-one

ID: ALA5287850

Max Phase: Preclinical

Molecular Formula: C15H11N5O

Molecular Weight: 277.29

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1c2cncn2c2ccccc2n1Cc1cnccn1

Standard InChI:  InChI=1S/C15H11N5O/c21-15-14-8-17-10-20(14)13-4-2-1-3-12(13)19(15)9-11-7-16-5-6-18-11/h1-8,10H,9H2

Standard InChI Key:  BWJUKAMRQIJDQU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 24  0  0  0  0  0  0  0  0999 V2000
    1.7862   -0.0349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0717    0.3774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3573   -0.0349    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3573   -0.8599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3571   -1.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0746   -0.8581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7862   -1.2745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7862   -2.0954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0700   -2.5080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3571   -2.0975    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3571    0.3775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0670   -0.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7832    0.3738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7832    1.2020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0688    1.6142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3571    1.2025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3573    1.6149    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5288    2.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3493    2.5080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6848    1.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0717    1.2025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  2  0
 11  3  1  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 11 16  2  0
 16 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 21 20  2  0
  2 21  1  0
 21 17  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287850

    ---

Associated Targets(Human)

GABRA5 Tclin GABA receptor alpha-5 subunit (699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GABRA1 Tclin GABA receptor alpha-1 subunit (399 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 277.29Molecular Weight (Monoisotopic): 277.0964AlogP: 1.49#Rotatable Bonds: 2
Polar Surface Area: 65.08Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.69CX LogP: 0.01CX LogD: 0.01
Aromatic Rings: 4Heavy Atoms: 21QED Weighted: 0.56Np Likeness Score: -1.37

References

1. Károlyi BI, Potor A, Kapus GL, Fodor L, Bobok A, Krámos B, Magdó I, Bata I, Szabó G..  (2023)  Novel imidazo[1,5-a]quinoxaline derivatives: SAR, selectivity and modeling challenges en route to the identification of an α5-GABAA receptor NAM.,  80  [PMID:36549396] [10.1016/j.bmcl.2022.129107]

Source