The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-amino-5-(4-chlorophenyl)-2-thioxo-2,5-dihydro-1H-pyrano[2,3-d]pyrimidin-7-yl)-2H-chromen-2-one ID: ALA5287867
Max Phase: Preclinical
Molecular Formula: C22H14ClN3O3S
Molecular Weight: 435.89
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(=S)[nH]c2c1C(c1ccc(Cl)cc1)C=C(c1cc3ccccc3oc1=O)O2
Standard InChI: InChI=1S/C22H14ClN3O3S/c23-13-7-5-11(6-8-13)14-10-17(28-20-18(14)19(24)25-22(30)26-20)15-9-12-3-1-2-4-16(12)29-21(15)27/h1-10,14H,(H3,24,25,26,30)
Standard InChI Key: GYAPFWUJHNYJOH-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
0.7157 3.0923 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.7157 2.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4322 1.8583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4322 1.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7147 0.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0010 1.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0010 1.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7147 -0.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4288 -0.6177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1431 -0.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1431 0.6196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8574 -0.6177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8574 -1.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5718 -1.8549 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.1431 -1.8548 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4288 -1.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7147 -1.8548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0005 -1.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7139 -1.8549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4284 -1.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1428 -1.8549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8604 -1.4409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5718 -1.8574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5718 -2.6782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8553 -3.0906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1428 -2.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4284 -3.0923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7139 -2.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0005 -3.0923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0005 -0.6177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
7 6 1 0
2 7 2 0
5 8 1 0
9 8 1 0
9 10 1 0
10 11 1 0
12 10 2 0
13 12 1 0
13 14 2 0
15 13 1 0
16 15 1 0
16 9 2 0
17 16 1 0
18 17 1 0
19 18 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
26 25 1 0
21 26 2 0
26 27 1 0
27 28 1 0
19 28 1 0
28 29 2 0
30 18 2 0
30 8 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.89Molecular Weight (Monoisotopic): 435.0444AlogP: 5.05#Rotatable Bonds: 2Polar Surface Area: 94.14Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.84CX Basic pKa: 0.10CX LogP: 3.44CX LogD: 3.32Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.34Np Likeness Score: -0.31
References 1. Elattar KM, El-Khateeb AY, Hamed SE.. (2022) Insights into the recent progress in the medicinal chemistry of pyranopyrimidine analogs., 13 (5.0): [PMID:35694689 ] [10.1039/d2md00076h ]