The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-3-methyl-2-[[5-[2-(p-tolyl)ethynyl]-2-thienyl]sulfonylamino]butanoic acid ID: ALA5287905
Max Phase: Preclinical
Molecular Formula: C18H19NO4S2
Molecular Weight: 377.49
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C#Cc2ccc(S(=O)(=O)N[C@H](C(=O)O)C(C)C)s2)cc1
Standard InChI: InChI=1S/C18H19NO4S2/c1-12(2)17(18(20)21)19-25(22,23)16-11-10-15(24-16)9-8-14-6-4-13(3)5-7-14/h4-7,10-12,17,19H,1-3H3,(H,20,21)/t17-/m0/s1
Standard InChI Key: MAMDBBMJAYDZQJ-KRWDZBQOSA-N
Molfile:
RDKit 2D
25 26 0 0 0 0 0 0 0 0999 V2000
-2.7554 1.8141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0410 2.2267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0410 3.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7556 3.4646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3262 3.4646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3262 1.8141 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6115 2.2267 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.1031 1.8141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8566 2.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4086 1.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9962 0.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1892 0.9937 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.4088 0.1075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8214 -0.6071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2341 -1.3218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0594 -1.3220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4701 -2.0350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0574 -2.7499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2362 -2.7515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8197 -2.0396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4700 -3.4646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0242 2.9414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3106 2.9583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7554 0.9889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4701 2.2268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 6
3 4 1 0
3 5 1 0
2 6 1 0
6 7 1 0
7 8 1 0
9 8 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 1 0
11 13 1 0
13 14 3 0
14 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
15 20 1 0
18 21 1 0
7 22 2 0
7 23 2 0
1 24 2 0
1 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 377.49Molecular Weight (Monoisotopic): 377.0756AlogP: 2.84#Rotatable Bonds: 5Polar Surface Area: 83.47Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.98CX Basic pKa: ┄CX LogP: 4.45CX LogD: 0.96Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.79Np Likeness Score: -0.98
References 1. Mondal S, Adhikari N, Banerjee S, Amin SA, Jha T.. (2020) Matrix metalloproteinase-9 (MMP-9) and its inhibitors in cancer: A minireview., 194 [PMID:32224379 ] [10.1016/j.ejmech.2020.112260 ]