Artemisone

ID: ALA5287926

Max Phase: Preclinical

Molecular Formula: C19H31NO6S

Molecular Weight: 401.53

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H]1CC[C@H]2[C@@H](C)C(N3CCS(=O)(=O)CC3)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@]32OO4

Standard InChI:  InChI=1S/C19H31NO6S/c1-12-4-5-15-13(2)16(20-8-10-27(21,22)11-9-20)23-17-19(15)14(12)6-7-18(3,24-17)25-26-19/h12-17H,4-11H2,1-3H3/t12-,13-,14+,15+,16?,17-,18+,19-/m1/s1

Standard InChI Key:  FDMUNKXWYMSZIR-BYPUTIKFSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    0.6049   -1.0848    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6049   -0.2597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1100    0.1526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1100    0.9777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7700    0.4826    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9075    1.1977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2101    1.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0351    1.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5225    2.2152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1923    1.9952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6049    1.3902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6049    2.2152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0274    2.7926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7975    2.6827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7149    3.0402    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3200    2.6277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3200    3.4527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0350    2.2152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0350    1.3902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3200    0.9777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3200    0.1526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0351   -0.2602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0350    0.5651    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3200   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3200   -2.3234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6049   -2.7363    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1101   -2.3234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1101   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1913   -3.4527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0169   -3.4527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  4  5  1  1
  6  4  1  0
  6  7  1  0
  7  8  1  1
  7  9  1  0
  9 10  1  0
 11 10  1  6
 11  4  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
  7 14  1  0
 12 15  1  6
 12 16  1  0
 16 17  1  6
 18 16  1  0
 19 18  1  0
 20 19  1  0
 11 20  1  0
 20 21  1  0
  2 21  1  0
 21 22  1  1
 20 23  1  6
 24  1  1  0
 25 24  1  0
 26 25  1  0
 27 26  1  0
 28 27  1  0
  1 28  1  0
 26 29  2  0
 26 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5287926

    ---

Associated Targets(non-human)

Plasmodium berghei (192651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasmodium yoelii (6656 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasmodium falciparum (966862 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 401.53Molecular Weight (Monoisotopic): 401.1872AlogP: 1.92#Rotatable Bonds: 1
Polar Surface Area: 74.30Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.06CX LogP: 2.21CX LogD: 2.21
Aromatic Rings: Heavy Atoms: 27QED Weighted: 0.62Np Likeness Score: 2.13

References

1. Sharma B, Singh P, Singh AK, Awasthi SK..  (2021)  Advancement of chimeric hybrid drugs to cure malaria infection: An overview with special emphasis on endoperoxide pharmacophores.,  219  [PMID:33989911] [10.1016/j.ejmech.2021.113408]

Source