The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Artemisone ID: ALA5287926
Max Phase: Preclinical
Molecular Formula: C19H31NO6S
Molecular Weight: 401.53
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H]1CC[C@H]2[C@@H](C)C(N3CCS(=O)(=O)CC3)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@]32OO4
Standard InChI: InChI=1S/C19H31NO6S/c1-12-4-5-15-13(2)16(20-8-10-27(21,22)11-9-20)23-17-19(15)14(12)6-7-18(3,24-17)25-26-19/h12-17H,4-11H2,1-3H3/t12-,13-,14+,15+,16?,17-,18+,19-/m1/s1
Standard InChI Key: FDMUNKXWYMSZIR-BYPUTIKFSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
0.6049 -1.0848 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6049 -0.2597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1100 0.1526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1100 0.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7700 0.4826 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9075 1.1977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2101 1.9677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0351 1.9677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5225 2.2152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1923 1.9952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6049 1.3902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6049 2.2152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0274 2.7926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7975 2.6827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7149 3.0402 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.3200 2.6277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3200 3.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0350 2.2152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0350 1.3902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3200 0.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3200 0.1526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0351 -0.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0350 0.5651 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.3200 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3200 -2.3234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6049 -2.7363 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.1101 -2.3234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1101 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1913 -3.4527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0169 -3.4527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
4 5 1 1
6 4 1 0
6 7 1 0
7 8 1 1
7 9 1 0
9 10 1 0
11 10 1 6
11 4 1 0
12 11 1 0
13 12 1 0
14 13 1 0
7 14 1 0
12 15 1 6
12 16 1 0
16 17 1 6
18 16 1 0
19 18 1 0
20 19 1 0
11 20 1 0
20 21 1 0
2 21 1 0
21 22 1 1
20 23 1 6
24 1 1 0
25 24 1 0
26 25 1 0
27 26 1 0
28 27 1 0
1 28 1 0
26 29 2 0
26 30 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 401.53Molecular Weight (Monoisotopic): 401.1872AlogP: 1.92#Rotatable Bonds: 1Polar Surface Area: 74.30Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.06CX LogP: 2.21CX LogD: 2.21Aromatic Rings: ┄Heavy Atoms: 27QED Weighted: 0.62Np Likeness Score: 2.13
References 1. Sharma B, Singh P, Singh AK, Awasthi SK.. (2021) Advancement of chimeric hybrid drugs to cure malaria infection: An overview with special emphasis on endoperoxide pharmacophores., 219 [PMID:33989911 ] [10.1016/j.ejmech.2021.113408 ]