N-(4-(7-methoxyimidazo[1,2-a]pyridin-3-yl)-2-methylphenyl)-5-nitrofuran-2-carboxamide

ID: ALA5287932

Max Phase: Preclinical

Molecular Formula: C20H16N4O5

Molecular Weight: 392.37

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccn2c(-c3ccc(NC(=O)c4ccc([N+](=O)[O-])o4)c(C)c3)cnc2c1

Standard InChI:  InChI=1S/C20H16N4O5/c1-12-9-13(16-11-21-18-10-14(28-2)7-8-23(16)18)3-4-15(12)22-20(25)17-5-6-19(29-17)24(26)27/h3-11H,1-2H3,(H,22,25)

Standard InChI Key:  OMQKLMVWHFHOEU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   -0.2939   -1.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2939   -0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0105   -0.4165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0105    0.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7254    0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8116    1.6454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6187    1.8170    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0312    1.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8416    0.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0916    0.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8885   -0.0693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1020   -0.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5409   -0.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7336   -0.2927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4791    0.4893    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2957    0.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4164    0.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4164   -0.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1308   -0.8252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8452   -0.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8452    0.4121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5596   -0.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6458   -1.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4523   -1.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8646   -1.1026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6896   -1.1026    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1020   -0.3882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1020   -1.8170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3128   -0.4899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  1  0
  6  5  2  0
  7  6  1  0
  8  7  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
 13 14  2  0
 15 14  1  0
 15  8  1  0
  5 15  1  0
 16  4  2  0
 17 16  1  0
  2 18  1  0
 18 17  2  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 20 22  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 26 27  2  0
 26 28  1  0
 29 25  1  0
 29 22  1  0
M  CHG  2  26   1  28  -1
M  END

Alternative Forms

  1. Parent:

    ALA5287932

    ---

Associated Targets(Human)

AGS (1999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MGC-803 (6426 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
STAT3 Tchem Signal transducer and activator of transcription 3 (3313 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.37Molecular Weight (Monoisotopic): 392.1121AlogP: 4.07#Rotatable Bonds: 5
Polar Surface Area: 111.91Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.66CX Basic pKa: 5.66CX LogP: 2.86CX LogD: 2.86
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.40Np Likeness Score: -1.84

References

1. Li H, Ouyang S, Zhang Y, Peng K, Fang W, Liu Z, Wang CY, Zhang X, Wang Y..  (2022)  Structural optimization of Imidazo[1, 2-a]pyridine derivatives for the treatment of gastric cancer via STAT3 signaling pathway.,  244  [PMID:36283181] [10.1016/j.ejmech.2022.114858]

Source