7-(5-(4-(2-(5-ethylpyridin-2-yl)ethoxy)benzyl)-2,4-dioxothiazolidin-3-yl)heptanenitrile

ID: ALA5287946

Max Phase: Preclinical

Molecular Formula: C26H31N3O3S

Molecular Weight: 465.62

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1ccc(CCOc2ccc(CC3SC(=O)N(CCCCCCC#N)C3=O)cc2)nc1

Standard InChI:  InChI=1S/C26H31N3O3S/c1-2-20-8-11-22(28-19-20)14-17-32-23-12-9-21(10-13-23)18-24-25(30)29(26(31)33-24)16-7-5-3-4-6-15-27/h8-13,19,24H,2-7,14,16-18H2,1H3

Standard InChI Key:  CZGPXOYLPJLKSG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   -2.1051    0.1846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3905    0.5969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6786    0.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6786   -0.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3887   -1.0519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1051   -0.6437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8197   -1.0564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5343   -0.6437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2490   -1.0564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9636   -0.6437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0360    0.5976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7506    0.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4652    0.5976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0840    0.0262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7532   -0.7081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9291   -0.6158    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.4652    1.4228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1658   -1.4228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8810    0.2398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4645   -0.3436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2616   -0.1300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8451   -0.7135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6422   -0.4999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2257   -1.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0227   -0.8698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6784   -1.0562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3905   -0.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3905    0.1812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6802    0.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9636    0.1849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8198   -0.6563    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1051    0.5937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8198    0.1812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  3 11  1  0
 11 12  1  0
 13 12  1  0
 13 14  1  0
 14 15  1  0
 16 15  1  0
 12 16  1  0
 13 17  2  0
 15 18  2  0
 14 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 26 10  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 10 30  1  0
 25 31  3  0
 28 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287946

    ---

Associated Targets(Human)

XDH Tclin Xanthine dehydrogenase (1038 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 465.62Molecular Weight (Monoisotopic): 465.2086AlogP: 5.35#Rotatable Bonds: 13
Polar Surface Area: 83.29Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.64CX LogP: 5.19CX LogD: 5.18
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -0.79

References

1. Naim MJ, Alam MJ, Ahmad S, Nawaz F, Shrivastava N, Sahu M, Alam O..  (2017)  Therapeutic journey of 2,4-thiazolidinediones as a versatile scaffold: An insight into structure activity relationship.,  129  [PMID:28231521] [10.1016/j.ejmech.2017.02.031]

Source