The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-6-amino-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-carboxy-propanoyl]amino]hexanoyl]amino]hexanoic acid ID: ALA5287949
Max Phase: Preclinical
Molecular Formula: C16H31N5O6
Molecular Weight: 389.45
Associated Items:
Names and Identifiers Canonical SMILES: NCCCC[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CC(=O)O)C(=O)O
Standard InChI: InChI=1S/C16H31N5O6/c17-7-3-1-5-11(20-14(24)10(19)9-13(22)23)15(25)21-12(16(26)27)6-2-4-8-18/h10-12H,1-9,17-19H2,(H,20,24)(H,21,25)(H,22,23)(H,26,27)/t10-,11-,12-/m0/s1
Standard InChI Key: NVFSJIXJZCDICF-SRVKXCTJSA-N
Molfile:
RDKit 2D
27 26 0 0 0 0 0 0 0 0999 V2000
-3.0851 -0.2003 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3639 0.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6827 -0.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0016 0.2003 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3205 -0.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3606 0.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0417 -0.2003 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7228 0.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4040 -0.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0851 0.2003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4040 -1.0016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7228 1.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4040 1.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4040 2.1635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0851 2.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0851 3.3656 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3606 1.0016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3205 -1.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3606 -1.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3606 -2.1636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0417 -2.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0417 -3.3656 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6827 -1.0016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3639 1.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6827 1.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6827 2.1635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0016 1.0016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
8 12 1 1
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
6 17 2 0
5 18 1 6
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
3 23 2 0
2 24 1 1
24 25 1 0
25 26 2 0
25 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 389.45Molecular Weight (Monoisotopic): 389.2274AlogP: -1.90#Rotatable Bonds: 15Polar Surface Area: 210.86Molecular Species: ZWITTERIONHBA: 7HBD: 7#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 10#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.39CX Basic pKa: 13.78CX LogP: -7.19CX LogD: -7.96Aromatic Rings: ┄Heavy Atoms: 27QED Weighted: 0.16Np Likeness Score: 0.55
References 1. Mou Y, Wen S, Li YX, Gao XX, Zhang X, Jiang ZY.. (2020) Recent progress in Keap1-Nrf2 protein-protein interaction inhibitors., 202 [PMID:32668381 ] [10.1016/j.ejmech.2020.112532 ]