The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(5-(thiophen-3-yl)-1H-benzo[d]imidazol-1-yl)phenyl)-N-(3-(trifluoromethyl)phenyl)acetamide ID: ALA5288067
Max Phase: Preclinical
Molecular Formula: C26H18F3N3OS
Molecular Weight: 477.51
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1ccc(-n2cnc3cc(-c4ccsc4)ccc32)cc1)Nc1cccc(C(F)(F)F)c1
Standard InChI: InChI=1S/C26H18F3N3OS/c27-26(28,29)20-2-1-3-21(14-20)31-25(33)12-17-4-7-22(8-5-17)32-16-30-23-13-18(6-9-24(23)32)19-10-11-34-15-19/h1-11,13-16H,12H2,(H,31,33)
Standard InChI Key: UUOLCUOQNSRILY-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-0.3067 -0.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4078 0.0631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1196 -0.3487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1196 -1.1739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4096 -1.5857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3067 -1.1776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0214 0.0633 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7748 -0.2720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3267 0.3408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9143 1.0551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1076 0.8836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0294 -1.0539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8363 -1.2257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3868 -0.6171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1369 0.1684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1834 -0.8305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4788 -1.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3020 -1.5569 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.5153 -0.7607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8240 -0.3118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8339 -1.5862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5480 -1.1739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2622 -1.5862 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5480 -0.3493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9765 -1.1739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9767 -0.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6891 0.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4035 -0.3512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4051 -1.1718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6937 -1.5881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6891 0.8858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9749 1.2981 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.5153 0.8858 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.1030 1.6000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
7 1 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 7 1 0
8 12 1 0
13 12 2 0
14 13 1 0
15 14 2 0
9 15 1 0
16 14 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 20 2 0
20 16 1 0
4 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
26 25 2 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 2 0
25 30 1 0
27 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.51Molecular Weight (Monoisotopic): 477.1123AlogP: 6.95#Rotatable Bonds: 5Polar Surface Area: 46.92Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.72CX Basic pKa: 4.79CX LogP: 6.52CX LogD: 6.52Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: -2.15
References 1. Sun D, Zhao Y, Zhang S, Zhang L, Liu B, Ouyang L.. (2020) Dual-target kinase drug design: Current strategies and future directions in cancer therapy., 188 [PMID:31931340 ] [10.1016/j.ejmech.2019.112025 ]