2-(4-(5-(thiophen-3-yl)-1H-benzo[d]imidazol-1-yl)phenyl)-N-(3-(trifluoromethyl)phenyl)acetamide

ID: ALA5288067

Max Phase: Preclinical

Molecular Formula: C26H18F3N3OS

Molecular Weight: 477.51

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Cc1ccc(-n2cnc3cc(-c4ccsc4)ccc32)cc1)Nc1cccc(C(F)(F)F)c1

Standard InChI:  InChI=1S/C26H18F3N3OS/c27-26(28,29)20-2-1-3-21(14-20)31-25(33)12-17-4-7-22(8-5-17)32-16-30-23-13-18(6-9-24(23)32)19-10-11-34-15-19/h1-11,13-16H,12H2,(H,31,33)

Standard InChI Key:  UUOLCUOQNSRILY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   -0.3067   -0.3491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4078    0.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1196   -0.3487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1196   -1.1739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4096   -1.5857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3067   -1.1776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0214    0.0633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7748   -0.2720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3267    0.3408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9143    1.0551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1076    0.8836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0294   -1.0539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8363   -1.2257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3868   -0.6171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1369    0.1684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1834   -0.8305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4788   -1.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3020   -1.5569    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5153   -0.7607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8240   -0.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8339   -1.5862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5480   -1.1739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2622   -1.5862    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5480   -0.3493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9765   -1.1739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9767   -0.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6891    0.0612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4035   -0.3512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4051   -1.1718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6937   -1.5881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6891    0.8858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9749    1.2981    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.5153    0.8858    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.1030    1.6000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  7  1  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  7  1  0
  8 12  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
  9 15  1  0
 16 14  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 16  1  0
  4 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 25 30  1  0
 27 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5288067

    ---

Associated Targets(Human)

RET Tclin Tyrosine-protein kinase receptor RET (6732 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KDR Tclin Vascular endothelial growth factor receptor 2 (20924 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 477.51Molecular Weight (Monoisotopic): 477.1123AlogP: 6.95#Rotatable Bonds: 5
Polar Surface Area: 46.92Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.72CX Basic pKa: 4.79CX LogP: 6.52CX LogD: 6.52
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: -2.15

References

1. Sun D, Zhao Y, Zhang S, Zhang L, Liu B, Ouyang L..  (2020)  Dual-target kinase drug design: Current strategies and future directions in cancer therapy.,  188  [PMID:31931340] [10.1016/j.ejmech.2019.112025]

Source