The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-(3-fluorophenyl)-1H-benzo[d]imidazol-2-yl)-N-(pyridin-3-yl)-1H-pyrazole-4-carboxamide ID: ALA5288087
Max Phase: Preclinical
Molecular Formula: C22H15FN6O
Molecular Weight: 398.40
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cccnc1)c1c[nH]nc1-c1nc2c(-c3cccc(F)c3)cccc2[nH]1
Standard InChI: InChI=1S/C22H15FN6O/c23-14-5-1-4-13(10-14)16-7-2-8-18-19(16)28-21(27-18)20-17(12-25-29-20)22(30)26-15-6-3-9-24-11-15/h1-12H,(H,25,29)(H,26,30)(H,27,28)
Standard InChI Key: RZLNCRZBVRRFAT-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
0.6148 -1.4012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3294 -0.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0412 -1.4008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0412 -2.2260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3311 -2.6378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6148 -2.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1729 -1.1452 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1731 -2.4857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6600 -1.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3294 -0.1606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6121 0.2536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6129 1.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3304 1.4936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0449 1.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0497 0.2551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4883 -1.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9748 -2.4851 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7622 -2.2293 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7622 -1.4014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9748 -1.1457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7604 -0.3456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3462 0.2400 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9604 -0.1312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1317 1.0400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7173 1.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5028 2.4232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7025 2.6378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1187 2.0560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3283 1.2553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7622 1.4971 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
1 7 1 0
6 8 1 0
8 9 1 0
9 7 2 0
10 2 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
10 15 1 0
15 14 2 0
16 9 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 20 2 0
20 16 1 0
20 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
14 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 398.40Molecular Weight (Monoisotopic): 398.1291AlogP: 4.41#Rotatable Bonds: 4Polar Surface Area: 99.35Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.23CX Basic pKa: 4.43CX LogP: 3.64CX LogD: 3.63Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.42Np Likeness Score: -1.76
References 1. Qin Z, Qin L, Feng X, Li Z, Bian J.. (2021) Development of Cdc2-like Kinase 2 Inhibitors: Achievements and Future Directions., 64 (18.0): [PMID:34519506 ] [10.1021/acs.jmedchem.1c00985 ]