3-(4-(3-fluorophenyl)-1H-benzo[d]imidazol-2-yl)-N-(pyridin-3-yl)-1H-pyrazole-4-carboxamide

ID: ALA5288087

Max Phase: Preclinical

Molecular Formula: C22H15FN6O

Molecular Weight: 398.40

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1cccnc1)c1c[nH]nc1-c1nc2c(-c3cccc(F)c3)cccc2[nH]1

Standard InChI:  InChI=1S/C22H15FN6O/c23-14-5-1-4-13(10-14)16-7-2-8-18-19(16)28-21(27-18)20-17(12-25-29-20)22(30)26-15-6-3-9-24-11-15/h1-12H,(H,25,29)(H,26,30)(H,27,28)

Standard InChI Key:  RZLNCRZBVRRFAT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    0.6148   -1.4012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3294   -0.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0412   -1.4008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0412   -2.2260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3311   -2.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6148   -2.2296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1729   -1.1452    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1731   -2.4857    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6600   -1.8154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3294   -0.1606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6121    0.2536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6129    1.0794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3304    1.4936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0449    1.0829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0497    0.2551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4883   -1.8154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9748   -2.4851    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7622   -2.2293    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7622   -1.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9748   -1.1457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7604   -0.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3462    0.2400    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9604   -0.1312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1317    1.0400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7173    1.6258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5028    2.4232    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7025    2.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1187    2.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3283    1.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7622    1.4971    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  1  7  1  0
  6  8  1  0
  8  9  1  0
  9  7  2  0
 10  2  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 10 15  1  0
 15 14  2  0
 16  9  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 16  1  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 24 29  1  0
 14 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5288087

    ---

Associated Targets(Human)

CLK2 Tchem Dual specificity protein kinase CLK2 (3942 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 398.40Molecular Weight (Monoisotopic): 398.1291AlogP: 4.41#Rotatable Bonds: 4
Polar Surface Area: 99.35Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.23CX Basic pKa: 4.43CX LogP: 3.64CX LogD: 3.63
Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.42Np Likeness Score: -1.76

References

1. Qin Z, Qin L, Feng X, Li Z, Bian J..  (2021)  Development of Cdc2-like Kinase 2 Inhibitors: Achievements and Future Directions.,  64  (18.0): [PMID:34519506] [10.1021/acs.jmedchem.1c00985]

Source