3-(((2-chloro-6-fluorobenzyl)thio)methyl)-7-(4-phenylpiperazine-1-carbonyl)-3,4-dihydroquinoxalin-2(1H)-one

ID: ALA5288093

Max Phase: Preclinical

Molecular Formula: C27H26ClFN4O2S

Molecular Weight: 525.05

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1Nc2cc(C(=O)N3CCN(c4ccccc4)CC3)ccc2NC1CSCc1c(F)cccc1Cl

Standard InChI:  InChI=1S/C27H26ClFN4O2S/c28-21-7-4-8-22(29)20(21)16-36-17-25-26(34)31-24-15-18(9-10-23(24)30-25)27(35)33-13-11-32(12-14-33)19-5-2-1-3-6-19/h1-10,15,25,30H,11-14,16-17H2,(H,31,34)

Standard InChI Key:  MROHAMKWAMGONL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    4.6445    0.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3590    0.6173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0709    0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0709   -0.6197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3608   -1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6445   -0.6234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3590    1.4425    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.9298   -1.0360    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.9298    0.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2151    0.2050    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5006    0.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7859    0.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7859   -0.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0712   -1.0326    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3567   -0.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3567    0.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0712    0.6176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5006   -1.0326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3560   -1.0309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0709   -0.6184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0727    0.2025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3611    0.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7855   -1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7855   -1.8562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5001   -0.6184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2147   -1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9294   -0.6184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9294    0.2066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2147    0.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5001    0.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6440    0.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3588    0.2068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0709    0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0709    1.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3606    1.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6440    1.4480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  2  7  1  0
  6  8  1  0
  1  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 13 12  1  0
 14 13  1  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 12 17  1  0
 13 18  2  0
 15 19  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 16 22  1  0
 20 23  1  0
 23 24  2  0
 23 25  1  0
 26 25  1  0
 27 26  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 25 30  1  0
 31 28  1  0
 32 31  2  0
 33 32  1  0
 34 33  2  0
 35 34  1  0
 31 36  1  0
 36 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5288093

    ---

Associated Targets(Human)

CLEC4M Tbio C-type lectin domain family 4 member M (115 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 525.05Molecular Weight (Monoisotopic): 524.1449AlogP: 5.11#Rotatable Bonds: 6
Polar Surface Area: 64.68Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.47CX Basic pKa: 3.42CX LogP: 4.79CX LogD: 4.79
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.47Np Likeness Score: -1.61

References

1. Sethi A, Sanam S, Alvala M..  (2021)  Non-carbohydrate strategies to inhibit lectin proteins with special emphasis on galectins.,  222  [PMID:34146913] [10.1016/j.ejmech.2021.113561]

Source