(R)-6-(2-Amino-1-cyclohexylethyl)-3-(pyridin-3-yl)-5,6-dihydrothieno[2,3-c]pyridin-7(4H)-one

ID: ALA5288132

Max Phase: Preclinical

Molecular Formula: C20H25N3OS

Molecular Weight: 355.51

Associated Items:

Names and Identifiers

Canonical SMILES:  NC[C@@H](C1CCCCC1)N1CCc2c(-c3cccnc3)csc2C1=O

Standard InChI:  InChI=1S/C20H25N3OS/c21-11-18(14-5-2-1-3-6-14)23-10-8-16-17(13-25-19(16)20(23)24)15-7-4-9-22-12-15/h4,7,9,12-14,18H,1-3,5-6,8,10-11,21H2/t18-/m0/s1

Standard InChI Key:  OFWAGEYNGXQUPC-SFHVURJKSA-N

Molfile:  

 
     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
   -0.2837   -0.0851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2837   -0.9101    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4283   -1.3185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1448   -0.9066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1403   -0.0851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4283    0.3314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9201    0.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4065   -0.4890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9273   -1.1561    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.1336    0.9697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5504    1.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7640    2.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5611    2.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1426    1.9817    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9339    1.1841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4287   -2.1435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9975   -1.3237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7126   -0.9122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9975   -2.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7120   -2.5611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4264   -1.3257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1414   -0.9143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1426   -0.0893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4288    0.3241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7138   -0.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  4  2  0
  5  6  1  0
  1  6  1  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  1  0
 10  7  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 10 15  1  0
  3 16  2  0
  2 17  1  0
 17 18  1  0
 17 19  1  1
 19 20  1  0
 21 18  1  0
 22 21  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
 18 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5288132

    ---

Associated Targets(Human)

DHPS Tchem Deoxyhypusine synthase (182 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 355.51Molecular Weight (Monoisotopic): 355.1718AlogP: 3.72#Rotatable Bonds: 4
Polar Surface Area: 59.22Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.17CX LogP: 3.03CX LogD: 1.28
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.91Np Likeness Score: -0.63

References

1. Tanaka Y, Kurasawa O, Yokota A, Klein MG, Saito B, Matsumoto S, Okaniwa M, Ambrus-Aikelin G, Uchiyama N, Morishita D, Kimura H, Imamura S..  (2020)  New Series of Potent Allosteric Inhibitors of Deoxyhypusine Synthase.,  11  (8.0): [PMID:34345355] [10.1021/acsmedchemlett.0c00331]

Source