(4-((2-amino-6-methyl-4-oxo-3,4-dihydroquinazolin-5-yl)thio)benzoyl)-L-phenylalanine

ID: ALA5288172

Max Phase: Preclinical

Molecular Formula: C25H22N4O4S

Molecular Weight: 474.54

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc2nc(N)[nH]c(=O)c2c1Sc1ccc(C(=O)N[C@@H](Cc2ccccc2)C(=O)O)cc1

Standard InChI:  InChI=1S/C25H22N4O4S/c1-14-7-12-18-20(23(31)29-25(26)28-18)21(14)34-17-10-8-16(9-11-17)22(30)27-19(24(32)33)13-15-5-3-2-4-6-15/h2-12,19H,13H2,1H3,(H,27,30)(H,32,33)(H3,26,28,29,31)/t19-/m0/s1

Standard InChI Key:  SISFXJRQKYLROK-IBGZPJMESA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    3.5609   -2.2597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5609   -1.4347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2725   -1.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9814   -1.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9814   -2.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2743   -2.6661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8495   -1.0240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1380   -1.4347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1380   -2.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8625   -2.6745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4177   -2.6499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4266   -1.0240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7151   -1.4347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7151   -2.2562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0037   -1.0240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7033   -1.4340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4167   -1.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4167   -0.2026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1281    0.2080    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1281    1.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8413    1.4358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8413    2.2605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5587    2.6745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2700    2.2580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2700    1.4374    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5536    1.0251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5536    0.2036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9814    2.6688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1299    2.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4212    2.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4212    1.4394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7098    1.0287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7051    0.2078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0037   -0.2023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  1  6  2  0
  7  2  1  0
  8  7  1  0
  8  9  1  1
  9 10  2  0
  9 11  1  0
 12  8  1  0
 13 12  1  0
 13 14  2  0
 15 13  1  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 21 20  2  0
 22 21  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 21 26  1  0
 26 27  2  0
 24 28  1  0
 29 22  2  0
 30 29  1  0
 31 30  2  0
 20 31  1  0
 31 32  1  0
 33 18  2  0
 34 33  1  0
 15 34  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5288172

    ---

Associated Targets(Human)

TYMS Tclin Thymidylate synthase (1651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.54Molecular Weight (Monoisotopic): 474.1362AlogP: 3.39#Rotatable Bonds: 7
Polar Surface Area: 138.17Molecular Species: ACIDHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 3.75CX Basic pKa: 3.12CX LogP: 3.37CX LogD: 0.61
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.32Np Likeness Score: -0.56

References

1. Alagarsamy V, Chitra K, Saravanan G, Solomon VR, Sulthana MT, Narendhar B..  (2018)  An overview of quinazolines: Pharmacological significance and recent developments.,  151  [PMID:29656203] [10.1016/j.ejmech.2018.03.076]

Source