The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Dimethyl 4-(3-((5-((4-(3-methoxyphenyl)piperidin-1-yl)methyl)-1,3,4-oxadiazol-2-yl)amino)phenyl)-2-methyl-1,4-dihydropyridine-3,5-dicarboxylate ID: ALA5288434
Max Phase: Preclinical
Molecular Formula: C31H35N5O6
Molecular Weight: 573.65
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1=CNC(C)=C(C(=O)OC)C1c1cccc(Nc2nnc(CN3CCC(c4cccc(OC)c4)CC3)o2)c1
Standard InChI: InChI=1S/C31H35N5O6/c1-19-27(30(38)41-4)28(25(17-32-19)29(37)40-3)22-8-5-9-23(15-22)33-31-35-34-26(42-31)18-36-13-11-20(12-14-36)21-7-6-10-24(16-21)39-2/h5-10,15-17,20,28,32H,11-14,18H2,1-4H3,(H,33,35)
Standard InChI Key: VJONTMHVHWZZQR-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
-4.2528 1.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5382 2.0608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8263 1.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8263 0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5364 0.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2528 0.8200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5364 -0.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8218 -0.8261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8226 -1.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5375 -2.0616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2493 -1.6524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2542 -0.8276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1116 2.0616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3970 1.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6435 1.9844 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0915 1.3715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5039 0.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3108 0.8287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0916 -0.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7330 -0.0571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1454 0.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9701 0.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3824 -0.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9701 -0.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1454 -0.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2071 -0.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6197 0.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4420 0.6563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8544 -0.0581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4455 -0.7696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6213 -0.7743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8579 -1.4838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6826 -1.4838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1076 -0.4138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1076 0.4109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3934 -0.8261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6791 -0.4138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1084 -2.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9684 -0.4153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6826 -0.8276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9684 0.4094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.6826 -1.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
7 5 1 0
8 7 1 0
9 8 2 0
10 9 1 0
11 10 1 0
7 12 1 0
12 11 2 0
3 13 1 0
13 14 1 0
15 14 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 14 1 0
17 19 1 0
19 20 1 0
21 20 1 0
22 21 1 0
23 22 1 0
24 23 1 0
25 24 1 0
20 25 1 0
26 23 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
26 31 1 0
31 30 2 0
30 32 1 0
32 33 1 0
8 34 1 0
34 35 2 0
34 36 1 0
36 37 1 0
9 38 1 0
12 39 1 0
39 40 1 0
39 41 2 0
40 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 573.65Molecular Weight (Monoisotopic): 573.2587AlogP: 4.39#Rotatable Bonds: 9Polar Surface Area: 128.05Molecular Species: NEUTRALHBA: 11HBD: 2#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.72CX Basic pKa: 6.83CX LogP: 2.70CX LogD: 2.73Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.35Np Likeness Score: -0.98
References 1. Ronchetti R, Moroni G, Carotti A, Gioiello A, Camaioni E.. (2021) Recent advances in urea- and thiourea-containing compounds: focus on innovative approaches in medicinal chemistry and organic synthesis., 12 (7.0): [PMID:34355177 ] [10.1039/D1MD00058F ]