(2S,3R,4R,6R)-2-(4-chloro-3-(4-ethylbenzyl)phenyl)-5,5-difluoro-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4-diol

ID: ALA5288495

Max Phase: Preclinical

Molecular Formula: C21H23ClF2O4

Molecular Weight: 412.86

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1ccc(Cc2cc([C@@H]3O[C@H](CO)C(F)(F)[C@H](O)[C@H]3O)ccc2Cl)cc1

Standard InChI:  InChI=1S/C21H23ClF2O4/c1-2-12-3-5-13(6-4-12)9-15-10-14(7-8-16(15)22)19-18(26)20(27)21(23,24)17(11-25)28-19/h3-8,10,17-20,25-27H,2,9,11H2,1H3/t17-,18+,19+,20-/m1/s1

Standard InChI Key:  RNHUKCXDFRUWSK-FUMNGEBKSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   -2.8568   -0.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1423    0.2064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4278   -0.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4278   -1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1423   -1.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8568   -1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7135    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7133    1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0008    1.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7136    1.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7152    0.2084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0038   -0.2078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4295   -0.2039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1438    0.2084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440    1.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8566    1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5710    1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5726    0.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8612   -0.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4280    1.4415    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.2854    1.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2854    2.2684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7135   -1.4435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1423   -2.2684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5711    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2854   -0.2060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6831   -1.0311    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2700   -1.7449    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  3  7  1  1
  8  7  2  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
  7 12  1  0
 12 11  2  0
 11 13  1  0
 13 14  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 14 19  1  0
 10 20  1  0
 17 21  1  0
 21 22  1  0
  4 23  1  6
  5 24  1  1
  1 25  1  1
 25 26  1  0
  6 27  1  0
  6 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5288495

    ---

Associated Targets(Human)

SLC5A2 Tclin Sodium/glucose cotransporter 2 (2000 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.86Molecular Weight (Monoisotopic): 412.1253AlogP: 3.28#Rotatable Bonds: 5
Polar Surface Area: 69.92Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.53CX Basic pKa: CX LogP: 4.20CX LogD: 4.20
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.70Np Likeness Score: 0.48

References

1. Bhattacharya S, Rathore A, Parwani D, Mallick C, Asati V, Agarwal S, Rajoriya V, Das R, Kashaw SK..  (2020)  An exhaustive perspective on structural insights of SGLT2 inhibitors: A novel class of antidiabetic agent.,  204  [PMID:32717480] [10.1016/j.ejmech.2020.112523]

Source