The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3R,4R,6R)-2-(4-chloro-3-(4-ethylbenzyl)phenyl)-5,5-difluoro-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4-diol ID: ALA5288495
Max Phase: Preclinical
Molecular Formula: C21H23ClF2O4
Molecular Weight: 412.86
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc(Cc2cc([C@@H]3O[C@H](CO)C(F)(F)[C@H](O)[C@H]3O)ccc2Cl)cc1
Standard InChI: InChI=1S/C21H23ClF2O4/c1-2-12-3-5-13(6-4-12)9-15-10-14(7-8-16(15)22)19-18(26)20(27)21(23,24)17(11-25)28-19/h3-8,10,17-20,25-27H,2,9,11H2,1H3/t17-,18+,19+,20-/m1/s1
Standard InChI Key: RNHUKCXDFRUWSK-FUMNGEBKSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
-2.8568 -0.2060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1423 0.2064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4278 -0.2060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4278 -1.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1423 -1.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8568 -1.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7135 0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7133 1.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0008 1.4416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7136 1.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7152 0.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0038 -0.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4295 -0.2039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1438 0.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1440 1.0332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8566 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5710 1.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5726 0.2105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8612 -0.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4280 1.4415 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.2854 1.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2854 2.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7135 -1.4435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1423 -2.2684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5711 0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2854 -0.2060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6831 -1.0311 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.2700 -1.7449 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 1 0
3 7 1 1
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
7 12 1 0
12 11 2 0
11 13 1 0
13 14 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 2 0
14 19 1 0
10 20 1 0
17 21 1 0
21 22 1 0
4 23 1 6
5 24 1 1
1 25 1 1
25 26 1 0
6 27 1 0
6 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.86Molecular Weight (Monoisotopic): 412.1253AlogP: 3.28#Rotatable Bonds: 5Polar Surface Area: 69.92Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.53CX Basic pKa: ┄CX LogP: 4.20CX LogD: 4.20Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.70Np Likeness Score: 0.48
References 1. Bhattacharya S, Rathore A, Parwani D, Mallick C, Asati V, Agarwal S, Rajoriya V, Das R, Kashaw SK.. (2020) An exhaustive perspective on structural insights of SGLT2 inhibitors: A novel class of antidiabetic agent., 204 [PMID:32717480 ] [10.1016/j.ejmech.2020.112523 ]