The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((3R,4S)-1-ethyl-4-hydroxy-4-(4-(p-tolyloxy)phenyl)piperidin-3-yl)(4-(p-tolyloxy)phenyl)methanone vHydrochloride ID: ALA5288524
Max Phase: Preclinical
Molecular Formula: C34H36ClNO4
Molecular Weight: 521.66
Associated Items:
Names and Identifiers Canonical SMILES: CCN1CC[C@@](O)(c2ccc(Oc3ccc(C)cc3)cc2)[C@H](C(=O)c2ccc(Oc3ccc(C)cc3)cc2)C1.Cl
Standard InChI: InChI=1S/C34H35NO4.ClH/c1-4-35-22-21-34(37,27-11-19-31(20-12-27)39-29-15-7-25(3)8-16-29)32(23-35)33(36)26-9-17-30(18-10-26)38-28-13-5-24(2)6-14-28;/h5-20,32,37H,4,21-23H2,1-3H3;1H/t32-,34+;/m0./s1
Standard InChI Key: AXYVGEITWULTOE-HGQBGHRSSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
4.1681 -0.4461 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.0001 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7143 0.6197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4288 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4288 -0.6177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7143 -1.0302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0001 -0.6177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7143 -1.8550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4285 -2.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7143 1.4443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4286 1.0321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4288 1.8569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1413 2.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8557 1.8549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8573 1.0342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1459 0.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5700 2.2673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2843 1.8549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9987 2.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7104 1.8553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7104 1.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0005 0.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2843 1.0266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7144 0.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4286 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4288 -0.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1413 -1.0280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8558 -0.6155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8573 0.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1459 0.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5700 -1.0279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2843 -0.6155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9987 -1.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7104 -0.6158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7104 0.2090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0005 0.6207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2843 0.2127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7144 1.4443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4246 0.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4246 0.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
4 3 1 0
5 4 1 0
6 5 1 0
7 6 1 0
2 7 1 0
6 8 1 0
8 9 1 0
3 10 1 1
3 11 1 0
12 11 2 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 2 0
11 16 1 0
14 17 1 0
17 18 1 0
19 18 2 0
20 19 1 0
21 20 2 0
22 21 1 0
23 22 2 0
18 23 1 0
2 24 1 1
24 25 1 0
26 25 2 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 2 0
25 30 1 0
28 31 1 0
31 32 1 0
33 32 2 0
34 33 1 0
35 34 2 0
36 35 1 0
37 36 2 0
32 37 1 0
24 38 2 0
21 39 1 0
35 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.66Molecular Weight (Monoisotopic): 521.2566AlogP: 7.30#Rotatable Bonds: 8Polar Surface Area: 59.00Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.59CX Basic pKa: 7.89CX LogP: 6.90CX LogD: 6.29Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.25Np Likeness Score: -0.20
References 1. Goel P, Alam O, Naim MJ, Nawaz F, Iqbal M, Alam MI.. (2018) Recent advancement of piperidine moiety in treatment of cancer- A review., 157 [PMID:30114660 ] [10.1016/j.ejmech.2018.08.017 ]