The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1r,3r,5r,7r)-N-(4-((4-fluoro-6-methoxyquinolin-8-yl)amino)pentyl)dispiro[adamantane-2,3'-[1,2,4,5]tetraoxane-6',1 ID: ALA5288606
Max Phase: Preclinical
Molecular Formula: C32H42FN3O6
Molecular Weight: 583.70
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NC(C)CCCNC(=O)C2CCC3(CC2)OOC2(OO3)C3CC4CC(C3)CC2C4)c2nccc(F)c2c1
Standard InChI: InChI=1S/C32H42FN3O6/c1-19(36-28-18-25(38-2)17-26-27(33)7-11-34-29(26)28)4-3-10-35-30(37)22-5-8-31(9-6-22)39-41-32(42-40-31)23-13-20-12-21(15-23)16-24(32)14-20/h7,11,17-24,36H,3-6,8-10,12-16H2,1-2H3,(H,35,37)
Standard InChI Key: OLVUNYPSRIBIGZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 48 0 0 0 0 0 0 0 0999 V2000
0.5255 -1.3058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0054 -0.6654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2999 0.1051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1145 0.2354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4090 1.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2235 1.1363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5182 1.9069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9981 2.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3328 2.0372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8530 1.3968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6677 1.5268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1857 0.8880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8911 0.1171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0807 -0.0140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5572 0.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8672 -0.8108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0703 -1.0244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0014 1.0179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2909 1.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7741 2.4217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9616 2.2924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5848 0.4345 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.8092 -0.7957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1037 -1.5663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9183 -1.6966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4385 -1.0562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1440 -0.2856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3293 -0.1553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7329 -1.8268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5476 -1.9571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0678 -1.3168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7732 -0.5461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9586 -0.4158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3705 -2.0928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1329 -2.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7390 -1.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4321 -1.1767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6666 -0.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4454 -0.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7301 -1.4896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1485 -1.9964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5848 -1.9082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
7 9 1 0
9 10 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
15 14 2 0
10 15 1 0
14 16 1 0
16 17 1 0
12 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
11 21 1 0
18 22 1 0
23 2 1 0
24 23 1 0
25 24 1 0
26 25 1 0
26 27 1 0
28 27 1 0
23 28 1 0
29 26 1 0
30 29 1 0
31 30 1 0
31 32 1 0
33 32 1 0
26 33 1 0
34 31 1 0
35 34 1 0
36 35 1 0
36 37 1 0
37 38 1 0
31 38 1 0
38 39 1 0
40 39 1 0
40 41 1 0
41 34 1 0
42 40 1 0
42 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 583.70Molecular Weight (Monoisotopic): 583.3058AlogP: 6.03#Rotatable Bonds: 8Polar Surface Area: 100.17Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.47CX LogP: 5.61CX LogD: 5.61Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.29Np Likeness Score: -0.10
References 1. Sharma B, Singh P, Singh AK, Awasthi SK.. (2021) Advancement of chimeric hybrid drugs to cure malaria infection: An overview with special emphasis on endoperoxide pharmacophores., 219 [PMID:33989911 ] [10.1016/j.ejmech.2021.113408 ]