(1,4-diazabicyclo[3.2.2]nonan-4-yl)(3-(4-fluorophenyl)-6,6-dimethyl-6,7-dihydropyrano[4,3-c]pyrazol-1(4H)-yl)methanone

ID: ALA5288633

Max Phase: Preclinical

Molecular Formula: C22H27FN4O2

Molecular Weight: 398.48

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1(C)Cc2c(c(-c3ccc(F)cc3)nn2C(=O)N2CCN3CCC2CC3)CO1

Standard InChI:  InChI=1S/C22H27FN4O2/c1-22(2)13-19-18(14-29-22)20(15-3-5-16(23)6-4-15)24-27(19)21(28)26-12-11-25-9-7-17(26)8-10-25/h3-6,17H,7-14H2,1-2H3

Standard InChI Key:  MLPSFSOANGAWIR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
    1.0519   -3.2834    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.8383   -2.4866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3878   -1.8820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1131   -1.0852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3163   -0.9204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2331   -1.5249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0140   -2.3217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0690   -0.1511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7277    0.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4421   -0.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1565    0.1236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1565    0.9479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4421    1.3601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7277    0.9479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0690    1.1952    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5636    0.5357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3163    1.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2606    2.5690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1131    2.1569    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3329    2.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6077    2.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2671    1.9371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9815    2.1294    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4594    1.4974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6352    1.4974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8167    2.9262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0747    3.2834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5698    1.6637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9815    0.9479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  7  2  1  0
  6  7  2  0
  8  5  1  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
 12 13  1  0
  9 14  2  0
 14 13  1  0
 14 15  1  0
  8 16  2  0
 15 16  1  0
 15 17  1  0
 17 18  2  0
 17 19  1  0
 20 19  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 19 25  1  0
 25 24  1  0
 23 26  1  0
 20 27  1  0
 27 26  1  0
 12 28  1  0
 12 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5288633

    ---

Associated Targets(Human)

UGCG Tclin Ceramide glucosyltransferase (308 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HTR3A Tclin Serotonin 3a (5-HT3a) receptor (3366 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Abcg2 ATP-binding cassette sub-family G member 2 (64 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 398.48Molecular Weight (Monoisotopic): 398.2118AlogP: 3.29#Rotatable Bonds: 1
Polar Surface Area: 50.60Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.77CX LogP: 2.05CX LogD: 1.52
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.74Np Likeness Score: -0.79

References

1. Roecker AJ, Schirripa KM, Loughran HM, Tong L, Liang T, Fillgrove KL, Kuo Y, Bleasby K, Collier H, Altman MD, Ford MC, Drolet RE, Cosden M, Jinn S, Hatcher NG, Yao L, Kandebo M, Vardigan JD, Flick RB, Liu X, Minnick C, Price LA, Watt ML, Lemaire W, Burlein C, Adam GC, Austin LA, Marcus JN, Smith SM, Fraley ME..  (2023)  Pyrazole Ureas as Low Dose, CNS Penetrant Glucosylceramide Synthase Inhibitors for the Treatment of Parkinson's Disease.,  14  (2.0): [PMID:36793422] [10.1021/acsmedchemlett.2c00441]

Source