The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
12-epi-lyngbyatoxin A ID: ALA5288713
Max Phase: Preclinical
Molecular Formula: C27H39N3O2
Molecular Weight: 437.63
Associated Items:
Names and Identifiers Canonical SMILES: C=C[C@@](C)(CCC=C(C)C)c1ccc2c3c(c[nH]c13)C[C@@H](CO)NC(=O)[C@@H](C(C)C)N2C
Standard InChI: InChI=1S/C27H39N3O2/c1-8-27(6,13-9-10-17(2)3)21-11-12-22-23-19(15-28-24(21)23)14-20(16-31)29-26(32)25(18(4)5)30(22)7/h8,10-12,15,18,20,25,28,31H,1,9,13-14,16H2,2-7H3,(H,29,32)/t20-,25+,27-/m0/s1
Standard InChI Key: KISDGNGREAJPQR-FESMNKHTSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
0.2188 0.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8514 -0.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7090 -0.8933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0658 -1.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6965 -0.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5592 0.1618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2792 -1.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3036 -2.5560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0903 -3.3524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0756 -2.1864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6586 -1.6034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4550 -1.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0378 -1.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8343 -1.4472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8245 -0.4374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5170 -1.7596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4352 -1.3006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9408 -0.8228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6839 -0.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3142 0.4429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4550 1.2553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0457 1.9650 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2693 2.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4915 1.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0786 1.2643 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7177 1.4777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0914 2.5560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8878 2.3426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1218 3.3524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2693 3.0755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2513 1.4685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8343 0.8856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
4 7 1 0
7 8 1 0
8 9 2 0
7 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
13 15 1 0
7 16 1 6
3 17 1 0
17 18 1 0
19 18 2 0
2 19 1 0
19 20 1 0
20 21 1 0
22 21 1 0
23 22 1 0
23 24 1 0
25 24 1 0
1 25 1 0
25 26 1 0
24 27 1 6
27 28 1 0
27 29 1 0
23 30 2 0
21 31 1 6
31 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 437.63Molecular Weight (Monoisotopic): 437.3042AlogP: 4.85#Rotatable Bonds: 7Polar Surface Area: 68.36Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.14CX Basic pKa: ┄CX LogP: 5.29CX LogD: 5.29Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: 2.25
References 1. Xu J, Zhang T, Yao J, Lu J, Liu Z, Ding L.. (2020) Recent advances in chemistry and bioactivity of marine cyanobacteria Moorea species., 201 [PMID:32652435 ] [10.1016/j.ejmech.2020.112473 ]