8-cyclopentyl-6-hydroxy-2-((4-(4-methylpiperazin-1-yl)phenyl)amino)pteridin-7(8H)-one

ID: ALA5288714

Max Phase: Preclinical

Molecular Formula: C22H27N7O2

Molecular Weight: 421.51

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CCN(c2ccc(Nc3ncc4nc(O)c(=O)n(C5CCCC5)c4n3)cc2)CC1

Standard InChI:  InChI=1S/C22H27N7O2/c1-27-10-12-28(13-11-27)16-8-6-15(7-9-16)24-22-23-14-18-19(26-22)29(17-4-2-3-5-17)21(31)20(30)25-18/h6-9,14,17H,2-5,10-13H2,1H3,(H,25,30)(H,23,24,26)

Standard InChI Key:  GMGNEQNIJZNIMI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    1.0727   -0.0169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7873    0.3953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4991   -0.0165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4991   -0.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7890   -1.2535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0727   -0.8454    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2138    0.3960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9284   -0.0165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9284   -0.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2138   -1.2543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6430    0.3960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6430   -1.2543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3580    0.3956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3565   -0.0169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2138    1.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5465    1.7059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8013    2.4904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6261    2.4904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8810    1.7059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3568   -0.8421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0697   -1.2528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7845   -0.8401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7861   -0.0190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0742    0.3974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4991   -1.2527    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4991   -2.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2137   -2.4904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9284   -2.0778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9284   -1.2527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2138   -0.8401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6430   -2.4904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  1  0
  9  8  1  0
 10  9  2  0
  4 10  1  0
  8 11  2  0
  9 12  1  0
  1 13  1  0
 13 14  1  0
 15  7  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
 20 14  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 14 24  1  0
 25 22  1  0
 25 26  1  0
 27 26  1  0
 28 27  1  0
 29 28  1  0
 25 30  1  0
 30 29  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5288714

    ---

Associated Targets(Human)

CCNE1 Tchem Cyclin-dependent kinase 2/cyclin E (1410 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 421.51Molecular Weight (Monoisotopic): 421.2226AlogP: 2.50#Rotatable Bonds: 4
Polar Surface Area: 99.41Molecular Species: ACIDHBA: 9HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 2.98CX Basic pKa: 7.96CX LogP: 0.36CX LogD: 0.28
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -1.24

References

1. Wang X, Ding L, Jiang H, Yuan X, Xiang L, Tang C..  (2023)  Synthesis and biological evaluation of novel pteridin-7(8H)-one derivatives as potent CDK2 inhibitors.,  88  [PMID:37060933] [10.1016/j.bmcl.2023.129284]

Source