The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-cyclopentyl-6-hydroxy-2-((4-(4-methylpiperazin-1-yl)phenyl)amino)pteridin-7(8H)-one ID: ALA5288714
Max Phase: Preclinical
Molecular Formula: C22H27N7O2
Molecular Weight: 421.51
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(c2ccc(Nc3ncc4nc(O)c(=O)n(C5CCCC5)c4n3)cc2)CC1
Standard InChI: InChI=1S/C22H27N7O2/c1-27-10-12-28(13-11-27)16-8-6-15(7-9-16)24-22-23-14-18-19(26-22)29(17-4-2-3-5-17)21(31)20(30)25-18/h6-9,14,17H,2-5,10-13H2,1H3,(H,25,30)(H,23,24,26)
Standard InChI Key: GMGNEQNIJZNIMI-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
1.0727 -0.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7873 0.3953 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4991 -0.0165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4991 -0.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7890 -1.2535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0727 -0.8454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2138 0.3960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9284 -0.0165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9284 -0.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2138 -1.2543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6430 0.3960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6430 -1.2543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3580 0.3956 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3565 -0.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2138 1.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5465 1.7059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8013 2.4904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6261 2.4904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8810 1.7059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3568 -0.8421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0697 -1.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7845 -0.8401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7861 -0.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0742 0.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4991 -1.2527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4991 -2.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2137 -2.4904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9284 -2.0778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9284 -1.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2138 -0.8401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6430 -2.4904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 1 0
9 8 1 0
10 9 2 0
4 10 1 0
8 11 2 0
9 12 1 0
1 13 1 0
13 14 1 0
15 7 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
20 14 2 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
14 24 1 0
25 22 1 0
25 26 1 0
27 26 1 0
28 27 1 0
29 28 1 0
25 30 1 0
30 29 1 0
28 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 421.51Molecular Weight (Monoisotopic): 421.2226AlogP: 2.50#Rotatable Bonds: 4Polar Surface Area: 99.41Molecular Species: ACIDHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.98CX Basic pKa: 7.96CX LogP: 0.36CX LogD: 0.28Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -1.24
References 1. Wang X, Ding L, Jiang H, Yuan X, Xiang L, Tang C.. (2023) Synthesis and biological evaluation of novel pteridin-7(8H)-one derivatives as potent CDK2 inhibitors., 88 [PMID:37060933 ] [10.1016/j.bmcl.2023.129284 ]