The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(1-(6-(4-phenoxyphenyl)pyrimidin-4-yl)piperidin-4-yl)-3-phenylurea ID: ALA5288756
Max Phase: Preclinical
Molecular Formula: C28H27N5O2
Molecular Weight: 465.56
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccccc1)NC1CCN(c2cc(-c3ccc(Oc4ccccc4)cc3)ncn2)CC1
Standard InChI: InChI=1S/C28H27N5O2/c34-28(31-22-7-3-1-4-8-22)32-23-15-17-33(18-16-23)27-19-26(29-20-30-27)21-11-13-25(14-12-21)35-24-9-5-2-6-10-24/h1-14,19-20,23H,15-18H2,(H2,31,32,34)
Standard InChI Key: AOTPOMLQIGIUHJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
1.6511 2.5007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0634 1.7861 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6515 1.0742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8264 1.0742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4146 1.7843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8227 2.5007 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4105 1.7843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8231 1.0697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6483 1.0697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0608 1.7843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6483 2.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8231 2.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8861 1.7843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2986 1.0697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1239 1.0697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8861 0.3550 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5364 0.3550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0641 0.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8894 0.3593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3001 -0.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8874 -1.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0663 -1.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6498 -0.3580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1240 -0.3597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5360 -1.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3615 -1.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7734 -0.3615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3652 0.3550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3000 -1.7829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1252 -1.7829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5380 -1.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3607 -1.0691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7734 -1.7840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3642 -2.4958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5395 -2.5007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
7 5 1 0
7 8 1 0
9 8 1 0
10 9 1 0
11 10 1 0
7 12 1 0
12 11 1 0
10 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
18 3 1 0
19 18 2 0
20 19 1 0
21 20 2 0
22 21 1 0
18 23 1 0
23 22 2 0
24 17 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
17 28 1 0
21 29 1 0
29 30 1 0
31 30 2 0
32 31 1 0
33 32 2 0
34 33 1 0
35 34 2 0
30 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.56Molecular Weight (Monoisotopic): 465.2165AlogP: 5.73#Rotatable Bonds: 6Polar Surface Area: 79.38Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.56CX Basic pKa: 4.84CX LogP: 5.22CX LogD: 5.22Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -1.55
References 1. Goel P, Alam O, Naim MJ, Nawaz F, Iqbal M, Alam MI.. (2018) Recent advancement of piperidine moiety in treatment of cancer- A review., 157 [PMID:30114660 ] [10.1016/j.ejmech.2018.08.017 ]