1-(1-(6-(4-phenoxyphenyl)pyrimidin-4-yl)piperidin-4-yl)-3-phenylurea

ID: ALA5288756

Max Phase: Preclinical

Molecular Formula: C28H27N5O2

Molecular Weight: 465.56

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccccc1)NC1CCN(c2cc(-c3ccc(Oc4ccccc4)cc3)ncn2)CC1

Standard InChI:  InChI=1S/C28H27N5O2/c34-28(31-22-7-3-1-4-8-22)32-23-15-17-33(18-16-23)27-19-26(29-20-30-27)21-11-13-25(14-12-21)35-24-9-5-2-6-10-24/h1-14,19-20,23H,15-18H2,(H2,31,32,34)

Standard InChI Key:  AOTPOMLQIGIUHJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    1.6511    2.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0634    1.7861    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6515    1.0742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8264    1.0742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4146    1.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8227    2.5007    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4105    1.7843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8231    1.0697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6483    1.0697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0608    1.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6483    2.4989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8231    2.4989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8861    1.7843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2986    1.0697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1239    1.0697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8861    0.3550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5364    0.3550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0641    0.3595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8894    0.3593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3001   -0.3535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8874   -1.0683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0663   -1.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6498   -0.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1240   -0.3597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5360   -1.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3615   -1.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7734   -0.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3652    0.3550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3000   -1.7829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1252   -1.7829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5380   -1.0683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3607   -1.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7734   -1.7840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3642   -2.4958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5395   -2.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  7  5  1  0
  7  8  1  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
  7 12  1  0
 12 11  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 18  3  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 22 21  1  0
 18 23  1  0
 23 22  2  0
 24 17  2  0
 25 24  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 17 28  1  0
 21 29  1  0
 29 30  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 30 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5288756

    ---

Associated Targets(Human)

IMR-32 (1082 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 465.56Molecular Weight (Monoisotopic): 465.2165AlogP: 5.73#Rotatable Bonds: 6
Polar Surface Area: 79.38Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.56CX Basic pKa: 4.84CX LogP: 5.22CX LogD: 5.22
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -1.55

References

1. Goel P, Alam O, Naim MJ, Nawaz F, Iqbal M, Alam MI..  (2018)  Recent advancement of piperidine moiety in treatment of cancer- A review.,  157  [PMID:30114660] [10.1016/j.ejmech.2018.08.017]

Source