The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-Amino-5-oxo-5H-chromeno[4,3-d]pyrimidin-2-yl)phenyl benzenesulfonate ID: ALA5288791
Max Phase: Preclinical
Molecular Formula: C23H15N3O5S
Molecular Weight: 445.46
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(-c2cccc(OS(=O)(=O)c3ccccc3)c2)nc2c1c(=O)oc1ccccc12
Standard InChI: InChI=1S/C23H15N3O5S/c24-21-19-20(17-11-4-5-12-18(17)30-23(19)27)25-22(26-21)14-7-6-8-15(13-14)31-32(28,29)16-9-2-1-3-10-16/h1-13H,(H2,24,25,26)
Standard InChI Key: NSVGYOZUXAGLPI-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
-2.4920 0.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7774 0.6193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0653 0.2073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0653 -0.6177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7756 -1.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4920 -0.6213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2075 -1.0339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9253 -0.6198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9271 0.2044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2126 0.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2179 1.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9394 1.8592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6494 1.4413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6442 0.6132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2075 -1.8592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7756 -1.8547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3509 0.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3506 1.4452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3622 1.8559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0770 1.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0786 0.6221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3668 0.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7932 0.2095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5078 0.6221 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.2225 0.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9211 1.3380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0961 1.3380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9373 0.6219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6494 0.2098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6494 -0.6155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9391 -1.0274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2225 -0.6192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 3 1 0
5 4 2 0
6 5 1 0
1 6 2 0
6 7 1 0
8 7 1 0
9 8 1 0
10 9 2 0
1 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
9 14 1 0
7 15 2 0
5 16 1 0
17 3 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
21 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
24 27 2 0
28 25 2 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 2 0
25 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.46Molecular Weight (Monoisotopic): 445.0732AlogP: 3.75#Rotatable Bonds: 4Polar Surface Area: 125.38Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.29CX LogP: 5.11CX LogD: 5.11Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.25Np Likeness Score: -0.79
References 1. Lv N, Sun M, Liu C, Li J.. (2017) Design and synthesis of 2-phenylpyrimidine coumarin derivatives as anticancer agents., 27 (19): [PMID:28888820 ] [10.1016/j.bmcl.2017.08.044 ]