The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-oxo-N-(4-(2-oxopyrrolidin-1-yl)benzyl)-4H-chromene-2-carboxamide ID: ALA5288865
Max Phase: Preclinical
Molecular Formula: C21H18N2O4
Molecular Weight: 362.39
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCc1ccc(N2CCCC2=O)cc1)c1cc(=O)c2ccccc2o1
Standard InChI: InChI=1S/C21H18N2O4/c24-17-12-19(27-18-5-2-1-4-16(17)18)21(26)22-13-14-7-9-15(10-8-14)23-11-3-6-20(23)25/h1-2,4-5,7-10,12H,3,6,11,13H2,(H,22,26)
Standard InChI Key: REAFJZKIZSICLE-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 30 0 0 0 0 0 0 0 0999 V2000
-4.5674 0.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5685 -0.6998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8557 -1.1116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8575 0.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1441 0.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1407 -0.6973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4274 -1.1052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7131 -0.6914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7165 0.1346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4342 0.5469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4387 1.3696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9995 -1.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9973 -1.9237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2882 -0.6875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4253 -1.0971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1367 -0.6838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8463 -1.0965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5573 -0.6839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5555 0.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8369 0.5488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1289 0.1339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2676 0.5571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0205 0.2256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5685 0.8392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1542 1.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3504 1.3756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7366 1.9237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
4 1 1 0
5 4 2 0
3 6 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
5 10 1 0
9 10 1 0
10 11 2 0
8 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 22 1 0
26 27 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 362.39Molecular Weight (Monoisotopic): 362.1267AlogP: 2.85#Rotatable Bonds: 4Polar Surface Area: 79.62Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.14CX Basic pKa: ┄CX LogP: 1.77CX LogD: 1.77Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.77Np Likeness Score: -1.23