(1R,2R,5S)-8'-(3-chloro-4-fluorobenzyl)-6'-hydroxy-2'-((S)-1-hydroxyethyl)-9',10'-dihydro-2'H-spiro[bicyclo[3.1.0]hexane-2,3'-imidazo[5,1-a][2,6]naphthyridine]-1',5',7'(8'H)-trione

ID: ALA5289058

Max Phase: Preclinical

Molecular Formula: C24H23ClFN3O5

Molecular Weight: 487.92

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H](O)N1C(=O)c2c3c(c(O)c(=O)n2[C@]12CC[C@H]1C[C@H]12)C(=O)N(Cc1ccc(F)c(Cl)c1)CC3

Standard InChI:  InChI=1S/C24H23ClFN3O5/c1-11(30)28-22(33)19-14-5-7-27(10-12-2-3-17(26)16(25)8-12)21(32)18(14)20(31)23(34)29(19)24(28)6-4-13-9-15(13)24/h2-3,8,11,13,15,30-31H,4-7,9-10H2,1H3/t11-,13-,15+,24-/m0/s1

Standard InChI Key:  AEGLKWHALSRNJG-WYNNWDDRSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   -4.4454    1.5706    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.7310    1.1581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0165    1.5703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3047    1.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3047    0.3334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0147   -0.0782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7310    0.3297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5279    0.1162    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5902    1.5710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8757    1.1585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1612    1.5710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5532    1.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5532    0.3334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1612   -0.0790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8757    0.3334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2709   -0.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9824    0.3360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9806    1.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2658    1.5692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2658    2.3943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6951    1.5694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1612    2.3961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6041   -0.2310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2782   -0.9670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4541   -0.8798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8176    0.5657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6590    0.5657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9445   -0.1537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2965   -0.6711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0674   -0.9722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8707   -1.4632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6907   -1.6815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5158   -1.6815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2782   -2.3961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5279    0.4296    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8840   -1.3857    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  2  7  1  0
  7  6  2  0
  7  8  1  0
  4  9  1  0
  9 10  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
 15 14  1  0
 10 15  1  0
 13 16  2  0
 16 17  1  0
 17 18  1  0
 12 19  2  0
 18 19  1  0
 19 20  1  0
 18 21  2  0
 11 22  2  0
 17 23  1  0
 23 24  1  0
 25 24  1  0
 16 25  1  0
 23 26  1  6
 26 27  1  0
 27 28  1  0
 29 28  1  0
 23 29  1  0
 28 30  1  0
 29 30  1  0
 25 31  2  0
 24 32  1  0
 32 33  1  1
 32 34  1  0
 28 35  1  6
 29 36  1  6
M  END

Alternative Forms

  1. Parent:

    ALA5289058

    ---

Associated Targets(non-human)

Human immunodeficiency virus (3636 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.92Molecular Weight (Monoisotopic): 487.1310AlogP: 2.42#Rotatable Bonds: 3
Polar Surface Area: 103.08Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.08CX Basic pKa: 0.45CX LogP: 1.31CX LogD: 1.23
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.69Np Likeness Score: -0.28

References

1. Wang Y, Gu SX, He Q, Fan R..  (2021)  Advances in the development of HIV integrase strand transfer inhibitors.,  225  [PMID:34425310] [10.1016/j.ejmech.2021.113787]

Source