The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5289062
Max Phase: Preclinical
Molecular Formula: C17H25NO5
Molecular Weight: 323.39
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H]1C[C@H]2OC(=O)C(CN(C)C)[C@H]2[C@H](O)[C@]2(C)C(=O)C3OC3[C@@H]12
Standard InChI: InChI=1S/C17H25NO5/c1-7-5-9-10(8(6-18(3)4)16(21)22-9)14(19)17(2)11(7)12-13(23-12)15(17)20/h7-14,19H,5-6H2,1-4H3/t7-,8?,9-,10-,11-,12?,13?,14+,17-/m1/s1
Standard InChI Key: ZYDCGTAZTFZXMV-MMTAMOCBSA-N
Molfile:
RDKit 2D
26 29 0 0 0 0 0 0 0 0999 V2000
-0.9451 1.2429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2970 1.7534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5073 1.5695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8661 0.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5079 0.0791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2970 -0.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9451 0.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7055 0.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8495 -0.0911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1125 -0.4842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5108 -0.9030 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7565 0.1579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2315 0.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7350 1.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9703 -0.6402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5651 1.5831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5651 -0.5044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1125 -1.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5108 2.5516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1589 2.0411 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9451 -0.4160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4505 1.4132 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.5079 -0.7472 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.8281 -1.7253 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8268 -2.5516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5438 -1.3121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 7 1 0
7 6 1 0
4 8 1 0
8 9 1 0
10 9 1 0
5 10 1 0
6 11 1 6
7 12 1 0
12 13 1 0
14 13 1 0
1 14 1 0
12 15 2 0
13 16 1 0
14 16 1 0
9 17 2 0
10 18 1 0
2 19 1 6
1 20 1 6
7 21 1 1
4 22 1 6
5 23 1 6
18 24 1 0
24 25 1 0
24 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 323.39Molecular Weight (Monoisotopic): 323.1733AlogP: 0.08#Rotatable Bonds: 2Polar Surface Area: 79.37Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.25CX LogP: 0.43CX LogD: -0.48Aromatic Rings: ┄Heavy Atoms: 23QED Weighted: 0.57Np Likeness Score: 2.34
References 1. Gomes AR, Varela CL, Tavares-da-Silva EJ, Roleira FMF.. (2020) Epoxide containing molecules: A good or a bad drug design approach., 201 [PMID:32526552 ] [10.1016/j.ejmech.2020.112327 ]