ID: ALA5289062

Max Phase: Preclinical

Molecular Formula: C17H25NO5

Molecular Weight: 323.39

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H]1C[C@H]2OC(=O)C(CN(C)C)[C@H]2[C@H](O)[C@]2(C)C(=O)C3OC3[C@@H]12

Standard InChI:  InChI=1S/C17H25NO5/c1-7-5-9-10(8(6-18(3)4)16(21)22-9)14(19)17(2)11(7)12-13(23-12)15(17)20/h7-14,19H,5-6H2,1-4H3/t7-,8?,9-,10-,11-,12?,13?,14+,17-/m1/s1

Standard InChI Key:  ZYDCGTAZTFZXMV-MMTAMOCBSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   -0.9451    1.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2970    1.7534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5073    1.5695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8661    0.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5079    0.0791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2970   -0.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9451    0.4103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7055    0.7071    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8495   -0.0911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1125   -0.4842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5108   -0.9030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7565    0.1579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2315    0.8174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7350    1.4910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9703   -0.6402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5651    1.5831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5651   -0.5044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1125   -1.3105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5108    2.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1589    2.0411    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9451   -0.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4505    1.4132    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5079   -0.7472    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8281   -1.7253    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8268   -2.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5438   -1.3121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  7  1  0
  7  6  1  0
  4  8  1  0
  8  9  1  0
 10  9  1  0
  5 10  1  0
  6 11  1  6
  7 12  1  0
 12 13  1  0
 14 13  1  0
  1 14  1  0
 12 15  2  0
 13 16  1  0
 14 16  1  0
  9 17  2  0
 10 18  1  0
  2 19  1  6
  1 20  1  6
  7 21  1  1
  4 22  1  6
  5 23  1  6
 18 24  1  0
 24 25  1  0
 24 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5289062

    ---

Associated Targets(Human)

HEp-2 (3859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 323.39Molecular Weight (Monoisotopic): 323.1733AlogP: 0.08#Rotatable Bonds: 2
Polar Surface Area: 79.37Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.25CX LogP: 0.43CX LogD: -0.48
Aromatic Rings: Heavy Atoms: 23QED Weighted: 0.57Np Likeness Score: 2.34

References

1. Gomes AR, Varela CL, Tavares-da-Silva EJ, Roleira FMF..  (2020)  Epoxide containing molecules: A good or a bad drug design approach.,  201  [PMID:32526552] [10.1016/j.ejmech.2020.112327]

Source