The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Chrotacumine K ID: ALA5289085
Max Phase: Preclinical
Molecular Formula: C18H21NO6
Molecular Weight: 347.37
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)O[C@H]1CN(C)CC[C@H]1c1c(O)cc(O)c2c(=O)cc(C)oc12
Standard InChI: InChI=1S/C18H21NO6/c1-9-6-12(21)17-14(23)7-13(22)16(18(17)24-9)11-4-5-19(3)8-15(11)25-10(2)20/h6-7,11,15,22-23H,4-5,8H2,1-3H3/t11-,15+/m1/s1
Standard InChI Key: LTVZFRYSQOSHSI-ABAIWWIYSA-N
Molfile:
RDKit 2D
25 27 0 0 0 0 0 0 0 0999 V2000
-0.7153 2.8866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7153 2.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4297 1.6495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4297 0.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1441 0.4086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7135 0.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0036 0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0036 1.6498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7088 2.0606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7088 2.8855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4235 1.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4254 0.8274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7139 0.4108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1398 0.4149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7135 -0.4117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0008 -0.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0008 -1.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7135 -2.0616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4279 -1.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4279 -0.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7135 -2.8866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7153 -0.4116 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4298 -0.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1441 -0.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4298 -1.6491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 2 0
3 4 1 0
4 5 1 0
4 6 2 0
6 7 1 0
8 2 1 0
7 8 2 0
8 9 1 0
9 10 2 0
11 9 1 0
12 11 2 0
7 13 1 0
13 12 1 0
12 14 1 0
15 6 1 1
15 16 1 0
17 16 1 0
18 17 1 0
19 18 1 0
15 20 1 0
20 19 1 0
18 21 1 0
16 22 1 1
22 23 1 0
23 24 1 0
23 25 2 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 347.37Molecular Weight (Monoisotopic): 347.1369AlogP: 1.86#Rotatable Bonds: 2Polar Surface Area: 100.21Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.19CX Basic pKa: 6.83CX LogP: 1.02CX LogD: 0.74Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.80Np Likeness Score: 1.77
References 1. Bai R, Yao C, Zhong Z, Ge J, Bai Z, Ye X, Xie T, Xie Y.. (2021) Discovery of natural anti-inflammatory alkaloids: Potential leads for the drug discovery for the treatment of inflammation., 213 [PMID:33454546 ] [10.1016/j.ejmech.2021.113165 ]