The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-4-((2-amino-6-methyl-4-oxo-3,4-dihydroquinazolin-5-yl)thio)-N-(1-phenylethyl)benzamide ID: ALA5289121
Max Phase: Preclinical
Molecular Formula: C24H22N4O2S
Molecular Weight: 430.53
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2nc(N)[nH]c(=O)c2c1Sc1ccc(C(=O)N[C@H](C)c2ccccc2)cc1
Standard InChI: InChI=1S/C24H22N4O2S/c1-14-8-13-19-20(23(30)28-24(25)27-19)21(14)31-18-11-9-17(10-12-18)22(29)26-15(2)16-6-4-3-5-7-16/h3-13,15H,1-2H3,(H,26,29)(H3,25,27,28,30)/t15-/m1/s1
Standard InChI Key: PQTLRNICONIUQW-OAHLLOKOSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-0.3568 0.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0713 1.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7812 0.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7812 -0.0010 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.0668 -0.4135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0668 -1.2420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3503 -1.6502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3597 -1.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0742 -1.6509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0742 -2.4758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7886 -1.2383 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5031 -1.6509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5031 -2.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2175 -1.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9351 -1.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6467 -1.2362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6467 -0.4153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9305 -0.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2175 -0.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3597 -0.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3521 -0.0012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4975 1.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2128 0.8194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2128 -0.0054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9322 1.2335 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9322 2.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6467 2.4701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2179 2.4758 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4975 2.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7831 2.4723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0713 2.0606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 1
12 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 14 2 0
8 20 2 0
20 21 1 0
21 5 2 0
22 3 2 0
22 23 1 0
23 24 2 0
25 23 1 0
26 25 1 0
26 27 1 0
28 26 2 0
29 28 1 0
29 22 1 0
30 29 2 0
31 30 1 0
2 31 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.53Molecular Weight (Monoisotopic): 430.1463AlogP: 4.46#Rotatable Bonds: 5Polar Surface Area: 100.87Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.23CX Basic pKa: 1.90CX LogP: 4.41CX LogD: 4.41Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: -0.96
References 1. Alagarsamy V, Chitra K, Saravanan G, Solomon VR, Sulthana MT, Narendhar B.. (2018) An overview of quinazolines: Pharmacological significance and recent developments., 151 [PMID:29656203 ] [10.1016/j.ejmech.2018.03.076 ]