(R)-4-((2-amino-6-methyl-4-oxo-3,4-dihydroquinazolin-5-yl)thio)-N-(1-phenylethyl)benzamide

ID: ALA5289121

Max Phase: Preclinical

Molecular Formula: C24H22N4O2S

Molecular Weight: 430.53

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc2nc(N)[nH]c(=O)c2c1Sc1ccc(C(=O)N[C@H](C)c2ccccc2)cc1

Standard InChI:  InChI=1S/C24H22N4O2S/c1-14-8-13-19-20(23(30)28-24(25)27-19)21(14)31-18-11-9-17(10-12-18)22(29)26-15(2)16-6-4-3-5-7-16/h3-13,15H,1-2H3,(H,26,29)(H3,25,27,28,30)/t15-/m1/s1

Standard InChI Key:  PQTLRNICONIUQW-OAHLLOKOSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   -0.3568    0.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0713    1.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7812    0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7812   -0.0010    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0668   -0.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0668   -1.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3503   -1.6502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3597   -1.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0742   -1.6509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0742   -2.4758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7886   -1.2383    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5031   -1.6509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5031   -2.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2175   -1.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9351   -1.6526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6467   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6467   -0.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9305   -0.0027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2175   -0.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3597   -0.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3521   -0.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4975    1.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2128    0.8194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2128   -0.0054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9322    1.2335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9322    2.0576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6467    2.4701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2179    2.4758    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4975    2.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7831    2.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0713    2.0606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  1
 12 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 14  2  0
  8 20  2  0
 20 21  1  0
 21  5  2  0
 22  3  2  0
 22 23  1  0
 23 24  2  0
 25 23  1  0
 26 25  1  0
 26 27  1  0
 28 26  2  0
 29 28  1  0
 29 22  1  0
 30 29  2  0
 31 30  1  0
  2 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5289121

    ---

Associated Targets(Human)

TYMS Tclin Thymidylate synthase (1651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 430.53Molecular Weight (Monoisotopic): 430.1463AlogP: 4.46#Rotatable Bonds: 5
Polar Surface Area: 100.87Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 11.23CX Basic pKa: 1.90CX LogP: 4.41CX LogD: 4.41
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: -0.96

References

1. Alagarsamy V, Chitra K, Saravanan G, Solomon VR, Sulthana MT, Narendhar B..  (2018)  An overview of quinazolines: Pharmacological significance and recent developments.,  151  [PMID:29656203] [10.1016/j.ejmech.2018.03.076]

Source