N-(3-fluoro-4-(7-methoxyimidazo[1,2-a]pyridin-3-yl)phenyl)-5-nitrofuran-2-carboxamide

ID: ALA5289129

Max Phase: Preclinical

Molecular Formula: C19H13FN4O5

Molecular Weight: 396.33

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccn2c(-c3ccc(NC(=O)c4ccc([N+](=O)[O-])o4)cc3F)cnc2c1

Standard InChI:  InChI=1S/C19H13FN4O5/c1-28-12-6-7-23-15(10-21-17(23)9-12)13-3-2-11(8-14(13)20)22-19(25)16-4-5-18(29-16)24(26)27/h2-10H,1H3,(H,22,25)

Standard InChI Key:  MKOWCHSGGDDBTK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   -2.7425   -0.2935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4870    0.4908    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0409    1.1060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8540    0.9329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1048    0.1446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5523   -0.4659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9041   -0.0694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1184   -0.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6271    1.8228    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8174    1.6507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7309    0.8275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0138    0.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0138   -0.4177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2948   -0.8272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4176   -0.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1343   -0.8278    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8510   -0.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8510    0.4134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5678   -0.8278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6542   -1.6505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4633   -1.8225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8769   -1.1062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7046   -1.1062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1184   -0.3893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1184   -1.8228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3234   -0.4913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4176    0.4139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2966    0.8272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7305   -0.8315    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  6  1  2  0
  5  6  1  0
  5  7  1  0
  7  8  1  0
  3  9  2  0
  9 10  1  0
 10 11  2  0
 11  2  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 17 19  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 23 24  2  0
 23 25  1  0
 26 22  1  0
 26 19  1  0
 15 27  2  0
 27 28  1  0
 28 12  2  0
 13 29  1  0
M  CHG  2  23   1  25  -1
M  END

Alternative Forms

  1. Parent:

    ALA5289129

    ---

Associated Targets(Human)

AGS (1999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MGC-803 (6426 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
STAT3 Tchem Signal transducer and activator of transcription 3 (3313 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 396.33Molecular Weight (Monoisotopic): 396.0870AlogP: 3.90#Rotatable Bonds: 5
Polar Surface Area: 111.91Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.27CX Basic pKa: 5.35CX LogP: 2.49CX LogD: 2.49
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.40Np Likeness Score: -1.92

References

1. Li H, Ouyang S, Zhang Y, Peng K, Fang W, Liu Z, Wang CY, Zhang X, Wang Y..  (2022)  Structural optimization of Imidazo[1, 2-a]pyridine derivatives for the treatment of gastric cancer via STAT3 signaling pathway.,  244  [PMID:36283181] [10.1016/j.ejmech.2022.114858]

Source