The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl (Z)-(3-((3-(2-((allyloxy)amino)-2-oxoethyl)-2,4-dioxothiazolidin-5-ylidene)methyl)benzoyl)-L-valinate ID: ALA5289135
Max Phase: Preclinical
Molecular Formula: C22H25N3O7S
Molecular Weight: 475.52
Associated Items:
Names and Identifiers Canonical SMILES: C=CCONC(=O)CN1C(=O)S/C(=C\c2cccc(C(=O)N[C@H](C(=O)OC)C(C)C)c2)C1=O
Standard InChI: InChI=1S/C22H25N3O7S/c1-5-9-32-24-17(26)12-25-20(28)16(33-22(25)30)11-14-7-6-8-15(10-14)19(27)23-18(13(2)3)21(29)31-4/h5-8,10-11,13,18H,1,9,12H2,2-4H3,(H,23,27)(H,24,26)/b16-11-/t18-/m0/s1
Standard InChI Key: WHLGTQWOSLWDOR-QMJOVRGKSA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
-3.2446 -0.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5772 0.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8235 -0.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1560 0.3229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2423 1.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9960 1.4789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6635 0.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4023 -0.0126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2650 0.4722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2650 1.2972 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.0497 1.5522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5346 0.8848 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0497 0.2173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3046 -0.5673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3596 0.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7722 1.5992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5972 1.5993 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0096 2.3138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8347 2.3138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2473 3.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8347 3.7428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3596 2.3138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3046 2.3369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9984 0.0241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1584 -1.1318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8259 -1.6168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5796 -1.2813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7396 -2.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9859 -2.7729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.4071 -2.9223 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3209 -3.7428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2473 -1.7663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5796 -0.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 3 1 0
5 4 2 0
6 5 1 0
6 7 2 0
7 2 1 0
4 8 1 0
8 9 2 0
10 9 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 9 1 0
13 14 2 0
12 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
21 20 2 0
16 22 2 0
11 23 2 0
1 24 2 0
1 25 1 0
25 26 1 0
26 27 1 6
26 28 1 0
28 29 2 0
28 30 1 0
30 31 1 0
27 32 1 0
27 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.52Molecular Weight (Monoisotopic): 475.1413AlogP: 1.88#Rotatable Bonds: 10Polar Surface Area: 131.11Molecular Species: ACIDHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.58CX Basic pKa: ┄CX LogP: 2.01CX LogD: 1.11Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.17Np Likeness Score: -1.28
References 1. Dak M, Šlachtová V, Šebela M, Bazgier V, Berka K, Smiejkowska N, Oorts L, Cappoen D, Brulíková L.. (2022) Novel heterocyclic hydroxamates as inhibitors of the mycobacterial zinc metalloprotease Zmp1 to probe its mechanism of function., 244 [PMID:36242986 ] [10.1016/j.ejmech.2022.114831 ]