N-(4-(N-(4,6-dimethylpyrimidin-2-yl)sulfamoyl)phenyl)-3-(2-hydroxyphenyl)-1H-pyrazole-5-carboxamide

ID: ALA5289161

Max Phase: Preclinical

Molecular Formula: C22H20N6O4S

Molecular Weight: 464.51

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=O)c3cc(-c4ccccc4O)n[nH]3)cc2)n1

Standard InChI:  InChI=1S/C22H20N6O4S/c1-13-11-14(2)24-22(23-13)28-33(31,32)16-9-7-15(8-10-16)25-21(30)19-12-18(26-27-19)17-5-3-4-6-20(17)29/h3-12,29H,1-2H3,(H,25,30)(H,26,27)(H,23,24,28)

Standard InChI Key:  OTRAAMBBLCVLFI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -2.5366   -1.2682    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3565   -1.1764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5341   -0.3796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2451    0.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2451    0.8518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9533    1.2616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6642    0.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6642    0.0271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9515   -0.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5341    1.2623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8232    0.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2076   -0.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4146   -0.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2021    0.4679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8341   -0.9055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0411   -0.6930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1715    0.0999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9623    0.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5429   -0.2696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3359   -0.0571    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.9165   -0.6376    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7095   -0.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9222    0.3677    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7129    0.5788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2936   -0.0018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0837   -0.7912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2925   -1.0082    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3359    0.7637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9165    0.5233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3331   -1.0591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5418   -1.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9254    1.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6642   -1.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  5 10  1  0
  3 11  1  0
 11 12  2  0
 12  1  1  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 22 27  1  0
 20 28  2  0
 20 29  2  0
 30 19  1  0
 31 30  2  0
 16 31  1  0
 24 32  1  0
 26 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5289161

    ---

Associated Targets(Human)

PHGDH Tchem D-3-phosphoglycerate dehydrogenase (883 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.51Molecular Weight (Monoisotopic): 464.1267AlogP: 3.24#Rotatable Bonds: 6
Polar Surface Area: 149.96Molecular Species: NEUTRALHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 6.88CX Basic pKa: 1.13CX LogP: 2.52CX LogD: 2.01
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -1.71

References

1. Zhao JY, Feng KR, Wang F, Zhang JW, Cheng JF, Lin GQ, Gao D, Tian P..  (2021)  A retrospective overview of PHGDH and its inhibitors for regulating cancer metabolism.,  217  [PMID:33756126] [10.1016/j.ejmech.2021.113379]

Source