The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(N-(4,6-dimethylpyrimidin-2-yl)sulfamoyl)phenyl)-3-(2-hydroxyphenyl)-1H-pyrazole-5-carboxamide ID: ALA5289161
Max Phase: Preclinical
Molecular Formula: C22H20N6O4S
Molecular Weight: 464.51
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=O)c3cc(-c4ccccc4O)n[nH]3)cc2)n1
Standard InChI: InChI=1S/C22H20N6O4S/c1-13-11-14(2)24-22(23-13)28-33(31,32)16-9-7-15(8-10-16)25-21(30)19-12-18(26-27-19)17-5-3-4-6-20(17)29/h3-12,29H,1-2H3,(H,25,30)(H,26,27)(H,23,24,28)
Standard InChI Key: OTRAAMBBLCVLFI-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-2.5366 -1.2682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3565 -1.1764 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5341 -0.3796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2451 0.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2451 0.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9533 1.2616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6642 0.8514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6642 0.0271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9515 -0.3787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5341 1.2623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8232 0.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2076 -0.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4146 -0.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2021 0.4679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8341 -0.9055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0411 -0.6930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1715 0.0999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9623 0.3110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5429 -0.2696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3359 -0.0571 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.9165 -0.6376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7095 -0.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9222 0.3677 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7129 0.5788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2936 -0.0018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0837 -0.7912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2925 -1.0082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3359 0.7637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9165 0.5233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3331 -1.0591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5418 -1.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9254 1.3718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6642 -1.3718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
5 10 1 0
3 11 1 0
11 12 2 0
12 1 1 0
12 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
17 16 2 0
18 17 1 0
19 18 2 0
19 20 1 0
20 21 1 0
21 22 1 0
23 22 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
22 27 1 0
20 28 2 0
20 29 2 0
30 19 1 0
31 30 2 0
16 31 1 0
24 32 1 0
26 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.51Molecular Weight (Monoisotopic): 464.1267AlogP: 3.24#Rotatable Bonds: 6Polar Surface Area: 149.96Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.88CX Basic pKa: 1.13CX LogP: 2.52CX LogD: 2.01Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -1.71
References 1. Zhao JY, Feng KR, Wang F, Zhang JW, Cheng JF, Lin GQ, Gao D, Tian P.. (2021) A retrospective overview of PHGDH and its inhibitors for regulating cancer metabolism., 217 [PMID:33756126 ] [10.1016/j.ejmech.2021.113379 ]