The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-(((4-methoxy-N-(4-phenylthiazol-2-yl)phenyl)sulfonamido)methyl)phenyl)sulfamic acid ID: ALA5289174
Max Phase: Preclinical
Molecular Formula: C23H21N3O6S3
Molecular Weight: 531.64
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)N(Cc2ccc(NS(=O)(=O)O)cc2)c2nc(-c3ccccc3)cs2)cc1
Standard InChI: InChI=1S/C23H21N3O6S3/c1-32-20-11-13-21(14-12-20)34(27,28)26(15-17-7-9-19(10-8-17)25-35(29,30)31)23-24-22(16-33-23)18-5-3-2-4-6-18/h2-14,16,25H,15H2,1H3,(H,29,30,31)
Standard InChI Key: ZUGLODFGEJEFGF-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
1.1332 1.9853 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.4150 1.5793 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2956 1.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0138 1.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0212 0.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7393 0.3609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4501 0.7798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1683 0.3737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8791 0.7925 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.8717 1.6176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4428 1.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7246 2.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4077 0.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7044 0.7925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0927 -0.0045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8479 1.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1186 0.3353 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.9258 -0.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1236 -0.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2017 0.2045 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2889 -1.2730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5628 1.9851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2750 1.5731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2750 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5646 0.3356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8479 0.7438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1234 -1.9878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2885 -2.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1140 -2.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5260 -1.9897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1177 -1.2730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5496 2.5689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5459 2.7001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9897 0.3349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7044 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
7 6 1 0
7 8 1 0
9 8 1 0
9 10 1 0
7 11 2 0
11 12 1 0
12 4 2 0
13 2 1 0
9 14 2 0
9 15 2 0
1 16 1 0
17 13 1 0
17 18 1 0
18 19 2 0
20 19 1 0
13 20 2 0
19 21 1 0
22 16 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
16 26 1 0
27 21 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
21 31 1 0
1 32 2 0
1 33 2 0
24 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 531.64Molecular Weight (Monoisotopic): 531.0592AlogP: 4.43#Rotatable Bonds: 9Polar Surface Area: 125.90Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: -1.75CX Basic pKa: ┄CX LogP: 2.39CX LogD: 1.74Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.31Np Likeness Score: -1.48
References 1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S.. (2020) Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors., 28 (23.0): [PMID:32992253 ] [10.1016/j.bmc.2020.115777 ]