(4-(((4-methoxy-N-(4-phenylthiazol-2-yl)phenyl)sulfonamido)methyl)phenyl)sulfamic acid

ID: ALA5289174

Max Phase: Preclinical

Molecular Formula: C23H21N3O6S3

Molecular Weight: 531.64

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)N(Cc2ccc(NS(=O)(=O)O)cc2)c2nc(-c3ccccc3)cs2)cc1

Standard InChI:  InChI=1S/C23H21N3O6S3/c1-32-20-11-13-21(14-12-20)34(27,28)26(15-17-7-9-19(10-8-17)25-35(29,30)31)23-24-22(16-33-23)18-5-3-2-4-6-18/h2-14,16,25H,15H2,1H3,(H,29,30,31)

Standard InChI Key:  ZUGLODFGEJEFGF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    1.1332    1.9853    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.4150    1.5793    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2956    1.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0138    1.5920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0212    0.7670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7393    0.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4501    0.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1683    0.3737    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8791    0.7925    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8717    1.6176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4428    1.6048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7246    2.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4077    0.7543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7044    0.7925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0927   -0.0045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8479    1.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1186    0.3353    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.9258   -0.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1236   -0.5582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2017    0.2045    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2889   -1.2730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5628    1.9851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2750    1.5731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2750    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5646    0.3356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8479    0.7438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1234   -1.9878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2885   -2.7001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1140   -2.7001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5260   -1.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1177   -1.2730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5496    2.5689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5459    2.7001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9897    0.3349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7044    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  7  6  1  0
  7  8  1  0
  9  8  1  0
  9 10  1  0
  7 11  2  0
 11 12  1  0
 12  4  2  0
 13  2  1  0
  9 14  2  0
  9 15  2  0
  1 16  1  0
 17 13  1  0
 17 18  1  0
 18 19  2  0
 20 19  1  0
 13 20  2  0
 19 21  1  0
 22 16  2  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 16 26  1  0
 27 21  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 21 31  1  0
  1 32  2  0
  1 33  2  0
 24 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5289174

    ---

Associated Targets(Human)

PTPRB Tchem Receptor-type tyrosine-protein phosphatase beta (330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 531.64Molecular Weight (Monoisotopic): 531.0592AlogP: 4.43#Rotatable Bonds: 9
Polar Surface Area: 125.90Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: -1.75CX Basic pKa: CX LogP: 2.39CX LogD: 1.74
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.31Np Likeness Score: -1.48

References

1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S..  (2020)  Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors.,  28  (23.0): [PMID:32992253] [10.1016/j.bmc.2020.115777]

Source