The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S,E)-5-Hydroxy-2-(4-hydroxyphenyl)-7-methoxy-2,3-dihydrochromen-4-(1-phenoxyformo)-hydrazide ID: ALA5289261
Max Phase: Preclinical
Molecular Formula: C24H22N2O6
Molecular Weight: 434.45
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(O)c2c(c1)O[C@H](c1ccc(O)cc1)C/C2=N\NC(=O)OCc1ccccc1
Standard InChI: InChI=1S/C24H22N2O6/c1-30-18-11-20(28)23-19(25-26-24(29)31-14-15-5-3-2-4-6-15)13-21(32-22(23)12-18)16-7-9-17(27)10-8-16/h2-12,21,27-28H,13-14H2,1H3,(H,26,29)/b25-19+/t21-/m0/s1
Standard InChI Key: QBDXMPJNXRQUHB-ARCUFYBBSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-2.8575 1.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1429 1.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4310 1.0336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4310 0.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1411 -0.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8575 0.2046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1411 -1.0285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7132 -0.2057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0016 0.2109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0034 1.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7183 1.4444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7112 1.4445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7114 2.2697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4243 2.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1391 2.2677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1407 1.4466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4289 1.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8537 2.6803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7132 -1.0309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0013 -1.4435 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7160 -1.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4306 -1.4435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7160 -0.2057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5721 1.4457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2867 1.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1452 -1.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8599 -1.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5747 -1.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2867 -1.4431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2867 -2.2685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5765 -2.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8599 -2.2722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
5 7 1 0
4 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
3 11 1 0
10 12 1 6
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
15 18 1 0
8 19 2 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
1 24 1 0
24 25 1 0
22 26 1 0
26 27 1 0
28 27 2 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 2 0
27 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.45Molecular Weight (Monoisotopic): 434.1478AlogP: 4.26#Rotatable Bonds: 5Polar Surface Area: 109.61Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.60CX Basic pKa: ┄CX LogP: 4.10CX LogD: 4.07Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: 0.34
References 1. Ferreira RJ, Gajdács M, Kincses A, Spengler G, Dos Santos DJVA, Ferreira MU.. (2020) Nitrogen-containing naringenin derivatives for reversing multidrug resistance in cancer., 28 (23.0): [PMID:33038666 ] [10.1016/j.bmc.2020.115798 ]