(S,E)-5-Hydroxy-2-(4-hydroxyphenyl)-7-methoxy-2,3-dihydrochromen-4-(1-phenoxyformo)-hydrazide

ID: ALA5289261

Max Phase: Preclinical

Molecular Formula: C24H22N2O6

Molecular Weight: 434.45

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)c2c(c1)O[C@H](c1ccc(O)cc1)C/C2=N\NC(=O)OCc1ccccc1

Standard InChI:  InChI=1S/C24H22N2O6/c1-30-18-11-20(28)23-19(25-26-24(29)31-14-15-5-3-2-4-6-15)13-21(32-22(23)12-18)16-7-9-17(27)10-8-16/h2-12,21,27-28H,13-14H2,1H3,(H,26,29)/b25-19+/t21-/m0/s1

Standard InChI Key:  QBDXMPJNXRQUHB-ARCUFYBBSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -2.8575    1.0331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1429    1.4454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4310    1.0336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4310    0.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1411   -0.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8575    0.2046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1411   -1.0285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7132   -0.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0016    0.2109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0034    1.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7183    1.4444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7112    1.4445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7114    2.2697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4243    2.6804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1391    2.2677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1407    1.4466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    1.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8537    2.6803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7132   -1.0309    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0013   -1.4435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7160   -1.0309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4306   -1.4435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7160   -0.2057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5721    1.4457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2867    1.0331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1452   -1.0309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8599   -1.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5747   -1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2867   -1.4431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2867   -2.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5765   -2.6804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8599   -2.2722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  5  7  1  0
  4  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  3 11  1  0
 10 12  1  6
 13 12  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 12 17  1  0
 15 18  1  0
  8 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
  1 24  1  0
 24 25  1  0
 22 26  1  0
 26 27  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5289261

    ---

Associated Targets(non-human)

L5178Y (1809 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.45Molecular Weight (Monoisotopic): 434.1478AlogP: 4.26#Rotatable Bonds: 5
Polar Surface Area: 109.61Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.60CX Basic pKa: CX LogP: 4.10CX LogD: 4.07
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: 0.34

References

1. Ferreira RJ, Gajdács M, Kincses A, Spengler G, Dos Santos DJVA, Ferreira MU..  (2020)  Nitrogen-containing naringenin derivatives for reversing multidrug resistance in cancer.,  28  (23.0): [PMID:33038666] [10.1016/j.bmc.2020.115798]

Source