(2S)-2-((S)-2-(((cyclohexyloxy)carbonyl)amino)-4-methylpentanamido)-1-hydroxy-3-((S)-2-oxopyrrolidin-3-yl)propane-1-sulfonic acid

ID: ALA5289335

Max Phase: Preclinical

Molecular Formula: C20H35N3O8S

Molecular Weight: 477.58

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](NC(=O)OC1CCCCC1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(O)S(=O)(=O)O

Standard InChI:  InChI=1S/C20H35N3O8S/c1-12(2)10-15(23-20(27)31-14-6-4-3-5-7-14)18(25)22-16(19(26)32(28,29)30)11-13-8-9-21-17(13)24/h12-16,19,26H,3-11H2,1-2H3,(H,21,24)(H,22,25)(H,23,27)(H,28,29,30)/t13-,15-,16-,19?/m0/s1

Standard InChI Key:  ORKNIPZHPCWIDI-AOTTWXCTSA-N

Molfile:  

 
     RDKit          2D

 32 33  0  0  0  0  0  0  0  0999 V2000
   -3.5729   -0.0822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8584   -0.4946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8584   -1.3197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5729   -1.7322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2874   -1.3197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2874   -0.4946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1439   -0.0822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4294   -0.4946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149   -0.0821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0004   -0.4946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7140   -0.0821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7140    0.7429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4285   -0.4946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1435   -0.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1435    0.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8584    1.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6122    0.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1644    1.4341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7518    2.1486    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9446    1.9770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3609    2.5608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8584   -0.4946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5729   -0.0821    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.1612    0.6337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9862    0.6337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2874   -0.4946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8584   -1.3191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0004   -1.3197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7140   -1.7322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7140   -2.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4287   -1.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4294   -1.3197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  7  2  1  0
  7  8  1  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
 11 12  2  0
 13 11  1  0
 14 13  1  1
 14 15  1  0
 16 15  1  1
 16 17  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 20 16  1  0
 20 21  2  0
 14 22  1  0
 22 23  1  0
 23 24  2  0
 23 25  2  0
 23 26  1  0
 22 27  1  0
 10 28  1  6
 28 29  1  0
 29 30  1  0
 31 29  1  0
  8 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5289335

    ---

Associated Targets(Human)

Huh-7 (12904 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

rep Replicase polyprotein 1ab (11336 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L929 (3802 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 477.58Molecular Weight (Monoisotopic): 477.2145AlogP: 0.68#Rotatable Bonds: 10
Polar Surface Area: 171.13Molecular Species: ACIDHBA: 7HBD: 5
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: -1.05CX Basic pKa: CX LogP: -0.47CX LogD: -1.77
Aromatic Rings: Heavy Atoms: 32QED Weighted: 0.29Np Likeness Score: 0.47

References

1. Gao K, Wang R, Chen J, Tepe JJ, Huang F, Wei GW..  (2021)  Perspectives on SARS-CoV-2 Main Protease Inhibitors.,  64  (23.0): [PMID:34798775] [10.1021/acs.jmedchem.1c00409]

Source