3-(cyclopropylmethyl)-5-(pyridin-2-ylmethyl)imidazo[1,5-a]quinoxalin-4(5H)-one

ID: ALA5289385

Max Phase: Preclinical

Molecular Formula: C20H18N4O

Molecular Weight: 330.39

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1c2c(CC3CC3)ncn2c2ccccc2n1Cc1ccccn1

Standard InChI:  InChI=1S/C20H18N4O/c25-20-19-16(11-14-8-9-14)22-13-24(19)18-7-2-1-6-17(18)23(20)12-15-5-3-4-10-21-15/h1-7,10,13-14H,8-9,11-12H2

Standard InChI Key:  VXYGMPPNCYIPDT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 29  0  0  0  0  0  0  0  0999 V2000
   -2.1041   -1.0600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3896   -1.4725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3896   -2.2939    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0995   -2.7028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8127   -2.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8127   -1.4746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6782   -1.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6782   -0.2403    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0330    0.1703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7444   -0.2403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0330    0.9918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6435    1.5413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3095    2.2917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5074    2.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6782    1.4025    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3896    0.9918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3896    0.1704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0965   -0.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8096    0.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8096    0.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0983    1.4018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4369    1.3288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0177    1.9096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8127    2.1226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2313    2.7028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  1  6  2  0
  6  5  1  0
  7  2  1  0
  8  7  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  2  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 11 15  1  0
 16 15  1  0
 17  8  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 20 19  1  0
 16 21  1  0
 21 20  2  0
 12 22  1  0
 22 23  1  0
 24 23  1  0
 24 25  1  0
 23 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5289385

    ---

Associated Targets(Human)

GABRA5 Tclin GABA receptor alpha-5 subunit (699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GABRA1 Tclin GABA receptor alpha-1 subunit (399 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 330.39Molecular Weight (Monoisotopic): 330.1481AlogP: 3.05#Rotatable Bonds: 4
Polar Surface Area: 52.19Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.12CX LogP: 2.33CX LogD: 2.33
Aromatic Rings: 4Heavy Atoms: 25QED Weighted: 0.58Np Likeness Score: -1.21

References

1. Károlyi BI, Potor A, Kapus GL, Fodor L, Bobok A, Krámos B, Magdó I, Bata I, Szabó G..  (2023)  Novel imidazo[1,5-a]quinoxaline derivatives: SAR, selectivity and modeling challenges en route to the identification of an α5-GABAA receptor NAM.,  80  [PMID:36549396] [10.1016/j.bmcl.2022.129107]

Source