The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-Amino-5-oxo-5H-chromeno[4,3-d]pyrimidin-2-yl)phenyl 4-methoxybenzenesulfonate ID: ALA5289403
Max Phase: Preclinical
Molecular Formula: C24H17N3O6S
Molecular Weight: 475.48
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)Oc2cccc(-c3nc(N)c4c(=O)oc5ccccc5c4n3)c2)cc1
Standard InChI: InChI=1S/C24H17N3O6S/c1-31-15-9-11-17(12-10-15)34(29,30)33-16-6-4-5-14(13-16)23-26-21-18-7-2-3-8-19(18)32-24(28)20(21)22(25)27-23/h2-13H,1H3,(H2,25,26,27)
Standard InChI Key: QYKARSUPXHMHIO-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-3.2066 0.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4920 0.6192 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7801 0.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7801 -0.6178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4901 -1.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2066 -0.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9221 -1.0340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6399 -0.6199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6417 0.2044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9272 0.6227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9325 1.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6540 1.8591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3641 1.4413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3587 0.6132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9221 -1.8591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4901 -1.8547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0653 0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0652 1.4452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3523 1.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3624 1.4431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3640 0.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3477 0.2054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0786 0.2095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7932 0.6220 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5078 0.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2227 0.6219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9348 0.2099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9348 -0.6155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2245 -1.0274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5078 -0.6192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2065 1.3380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3815 1.3380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6494 -1.0281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3641 -0.6155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 3 1 0
5 4 2 0
6 5 1 0
1 6 2 0
6 7 1 0
8 7 1 0
9 8 1 0
10 9 2 0
1 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
9 14 1 0
7 15 2 0
5 16 1 0
17 3 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
21 23 1 0
23 24 1 0
24 25 1 0
26 25 2 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 2 0
25 30 1 0
24 31 2 0
24 32 2 0
28 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.48Molecular Weight (Monoisotopic): 475.0838AlogP: 3.76#Rotatable Bonds: 5Polar Surface Area: 134.61Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.29CX LogP: 4.91CX LogD: 4.91Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.23Np Likeness Score: -0.74
References 1. Lv N, Sun M, Liu C, Li J.. (2017) Design and synthesis of 2-phenylpyrimidine coumarin derivatives as anticancer agents., 27 (19): [PMID:28888820 ] [10.1016/j.bmcl.2017.08.044 ]