3-(4-Amino-5-oxo-5H-chromeno[4,3-d]pyrimidin-2-yl)phenyl 4-methoxybenzenesulfonate

ID: ALA5289403

Max Phase: Preclinical

Molecular Formula: C24H17N3O6S

Molecular Weight: 475.48

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)Oc2cccc(-c3nc(N)c4c(=O)oc5ccccc5c4n3)c2)cc1

Standard InChI:  InChI=1S/C24H17N3O6S/c1-31-15-9-11-17(12-10-15)34(29,30)33-16-6-4-5-14(13-16)23-26-21-18-7-2-3-8-19(18)32-24(28)20(21)22(25)27-23/h2-13H,1H3,(H2,25,26,27)

Standard InChI Key:  QYKARSUPXHMHIO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   -3.2066    0.2069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4920    0.6192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7801    0.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7801   -0.6178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4901   -1.0296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2066   -0.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9221   -1.0340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6399   -0.6199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6417    0.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9272    0.6227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9325    1.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6540    1.8591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3641    1.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3587    0.6132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9221   -1.8591    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4901   -1.8547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0653    0.6199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0652    1.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3523    1.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3624    1.4431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3640    0.6220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3477    0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0786    0.2095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7932    0.6220    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5078    0.2095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2227    0.6219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9348    0.2099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9348   -0.6155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2245   -1.0274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5078   -0.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2065    1.3380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3815    1.3380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6494   -1.0281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3641   -0.6155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  1  6  2  0
  6  7  1  0
  8  7  1  0
  9  8  1  0
 10  9  2  0
  1 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
  9 14  1  0
  7 15  2  0
  5 16  1  0
 17  3  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 25 30  1  0
 24 31  2  0
 24 32  2  0
 28 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5289403

    ---

Associated Targets(Human)

CNE-2 (385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KB (17409 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CAL-27 (814 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.48Molecular Weight (Monoisotopic): 475.0838AlogP: 3.76#Rotatable Bonds: 5
Polar Surface Area: 134.61Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.29CX LogP: 4.91CX LogD: 4.91
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.23Np Likeness Score: -0.74

References

1. Lv N, Sun M, Liu C, Li J..  (2017)  Design and synthesis of 2-phenylpyrimidine coumarin derivatives as anticancer agents.,  27  (19): [PMID:28888820] [10.1016/j.bmcl.2017.08.044]

Source