(5S,11aR)-2-cyclohexyl-5-(4-methoxyphenyl)-3-thioxo-2,3,5,6,11,11a-hexahydro-1H-imidazo[1',5':1,6]pyrido[3,4-b]indol-1-one

ID: ALA5289415

Max Phase: Preclinical

Molecular Formula: C26H27N3O2S

Molecular Weight: 445.59

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc([C@H]2c3[nH]c4ccccc4c3C[C@@H]3C(=O)N(C4CCCCC4)C(=S)N23)cc1

Standard InChI:  InChI=1S/C26H27N3O2S/c1-31-18-13-11-16(12-14-18)24-23-20(19-9-5-6-10-21(19)27-23)15-22-25(30)28(26(32)29(22)24)17-7-3-2-4-8-17/h5-6,9-14,17,22,24,27H,2-4,7-8,15H2,1H3/t22-,24+/m1/s1

Standard InChI Key:  CHBSFJVFMYDDOV-VWNXMTODSA-N

Molfile:  

 
     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
   -3.3906    0.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6760    0.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9642    0.0130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9642   -0.8121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6742   -1.2239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3906   -0.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1794   -1.0670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1794    0.2679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6944   -0.3996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8436    1.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0230    1.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4619    0.4403    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1262   -0.3134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5387   -1.0280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3641   -1.0283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7748   -1.7411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3620   -2.4560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5409   -2.4575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1244   -1.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7746   -3.1707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5998   -3.1707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2467    0.6952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4620    1.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2467    1.5203    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9614    1.9329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9614    2.7581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6760    3.1707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3906    2.7581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3906    1.9329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6760    1.5203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2484    2.5724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9613    0.2826    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4356    1.8225    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  1  0
  3  8  1  0
  8  9  2  0
  9  7  1  0
  8 10  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
  9 13  1  0
 13 14  1  1
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 14 19  1  0
 19 18  2  0
 17 20  1  0
 20 21  1  0
 12 22  1  0
 11 23  1  0
 23 24  1  0
 24 22  1  0
 25 24  1  0
 25 26  1  0
 27 26  1  0
 28 27  1  0
 29 28  1  0
 25 30  1  0
 30 29  1  0
 23 31  2  0
 22 32  2  0
 11 33  1  1
M  END

Alternative Forms

  1. Parent:

    ALA5289415

    ---

Associated Targets(Human)

DHODH Tclin Dihydroorotate dehydrogenase (2737 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 445.59Molecular Weight (Monoisotopic): 445.1824AlogP: 4.95#Rotatable Bonds: 3
Polar Surface Area: 48.57Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.86CX Basic pKa: CX LogP: 5.31CX LogD: 5.31
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.58Np Likeness Score: -0.34

References

1. Baiazitov RY, Qi H, Arasu T, Lennox W, Cao L, Weetall M, Furia B, Zhuo J, Choi S, Kim MJ, Sheedy J, Davis T, Moon YC..  (2022)  SAR studies toward discovery of emvododstat (PTC299), a potent dihydroorotate dehydrogenase (DHODH) inhibitor.,  244  [PMID:36242990] [10.1016/j.ejmech.2022.114826]

Source