The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-methoxy-6-(methoxymethyl)-N-(5-(4-((5-(trifluoromethyl)pyridin-2-yl)oxy)phenyl)pent-4-yn-2-yl)pyrimidin-4-amine ID: ALA5289621
Max Phase: Preclinical
Molecular Formula: C24H23F3N4O3
Molecular Weight: 472.47
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCc1ncnc(NC(C)CC#Cc2ccc(Oc3ccc(C(F)(F)F)cn3)cc2)c1OC
Standard InChI: InChI=1S/C24H23F3N4O3/c1-16(31-23-22(33-3)20(14-32-2)29-15-30-23)5-4-6-17-7-10-19(11-8-17)34-21-12-9-18(13-28-21)24(25,26)27/h7-13,15-16H,5,14H2,1-3H3,(H,29,30,31)
Standard InChI Key: ORODXUKIERSXLF-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
-5.3020 1.4445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5874 1.8568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8756 1.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8756 0.6197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5856 0.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3020 0.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0167 0.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0167 -0.6217 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.8418 0.2034 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.4293 0.9180 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.1609 1.8575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4462 1.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7315 1.8572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0194 1.4452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0194 0.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7296 0.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4462 0.6161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3047 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4098 -0.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1244 -0.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8391 -0.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5537 -0.6179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8391 0.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2683 -0.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2686 0.6199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9815 1.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6963 0.6178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6979 -0.2032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9861 -0.6197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9861 -1.4449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7007 -1.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4125 -0.6157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1272 -0.2032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8418 -0.6157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
6 7 1 0
7 8 1 0
7 9 1 0
7 10 1 0
3 11 1 0
11 12 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
15 18 1 0
18 19 3 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 1 0
22 24 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
29 30 1 0
30 31 1 0
28 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.47Molecular Weight (Monoisotopic): 472.1722AlogP: 5.08#Rotatable Bonds: 8Polar Surface Area: 78.39Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.79CX LogP: 4.58CX LogD: 4.57Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -1.12
References 1. Winter C, Siepe I, Wise A, Dorali A, Barrett AGM, Witschel M.. (2023) Agrochemical Lessons for Infectious Disease Research: New Resistance Breaking Antifungal Hits against Candida auris ., 14 (2.0): [PMID:36793433 ] [10.1021/acsmedchemlett.2c00497 ]