1-(2-ethyl-1,2,3,4-tetrahydro-5H-pyrido[4,3-b]indol-5-yl)-3-(1,2,3,4-tetrahydro-9H-carbazol-9-yl)propan-2-ol hydrochloride

ID: ALA5289632

Max Phase: Preclinical

Molecular Formula: C28H34ClN3O

Molecular Weight: 427.59

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN1CCc2c(c3ccccc3n2CC(O)Cn2c3c(c4ccccc42)CCCC3)C1.Cl

Standard InChI:  InChI=1S/C28H33N3O.ClH/c1-2-29-16-15-28-24(19-29)23-11-5-8-14-27(23)31(28)18-20(32)17-30-25-12-6-3-9-21(25)22-10-4-7-13-26(22)30;/h3,5-6,8-9,11-12,14,20,32H,2,4,7,10,13,15-19H2,1H3;1H

Standard InChI Key:  OLDAQKWWBFGEIZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   -1.8090   -2.0782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5083   -2.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2383   -2.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2627   -1.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5621   -0.8659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8351   -1.2573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2382   -0.6868    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5963    0.0570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4146   -0.0536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9176    0.5979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6045    1.3622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7905    1.4740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2820    0.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1883    1.9460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4406   -0.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1431   -0.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9407   -0.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0705    0.4808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5245    0.0533    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3954    0.8685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1308    1.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7144    0.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3397   -0.0756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7057    1.3171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7486    2.1415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4794    2.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1739    2.0710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5361    0.7021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9859    0.0099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6146   -0.7225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7912   -0.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9859    1.7323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9116    1.8148    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  8  7  1  0
  9  8  2  0
  5  9  1  0
  9 10  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
  8 13  1  0
 11 14  1  0
  7 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 17 19  1  0
 20 19  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 19  1  0
 20 24  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 21 27  1  0
 22 28  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 23 31  1  0
 14 32  1  0
M  END

Associated Targets(Human)

BCHE Tclin Butyrylcholinesterase (7174 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.59Molecular Weight (Monoisotopic): 427.2624AlogP: 4.91#Rotatable Bonds: 5
Polar Surface Area: 33.33Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.41CX LogP: 5.04CX LogD: 4.73
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.49Np Likeness Score: -0.63

References

1. Dai J, Dan W, Zhang Y, Wang J..  (2018)  Recent developments on synthesis and biological activities of γ-carboline.,  157  [PMID:30103193] [10.1016/j.ejmech.2018.08.015]

Source