The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(benzyloxy)-7,12-dihydropyrido[3,2-b:5,4-b']diindole ID: ALA5289687
Max Phase: Preclinical
Molecular Formula: C24H17N3O
Molecular Weight: 363.42
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc(COc2ccc3c(c2)[nH]c2c3ncc3[nH]c4ccccc4c32)cc1
Standard InChI: InChI=1S/C24H17N3O/c1-2-6-15(7-3-1)14-28-16-10-11-18-20(12-16)27-24-22-17-8-4-5-9-19(17)26-21(22)13-25-23(18)24/h1-13,26-27H,14H2
Standard InChI Key: LRKGLCIMHZWMMK-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 33 0 0 0 0 0 0 0 0999 V2000
-2.1178 -2.9240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4032 -2.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6914 -2.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6914 -3.7489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4015 -4.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1178 -3.7527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0914 -3.9949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5835 -3.3271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1127 -2.6734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4434 -1.9390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2448 -1.8581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7157 -2.5118 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3850 -3.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4156 -1.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7198 -0.6652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1189 -1.2018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7237 0.1377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4230 0.5379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1163 0.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1178 -0.6693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4230 1.3433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7255 1.7461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7255 2.5516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0279 2.9546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0287 3.7577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7265 4.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4214 3.7612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4261 2.9561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
4 7 1 0
7 8 1 0
9 8 2 0
3 9 1 0
9 10 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
11 14 1 0
15 14 2 0
10 16 1 0
16 15 1 0
15 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
14 20 1 0
18 21 1 0
21 22 1 0
22 23 1 0
24 23 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
23 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 363.42Molecular Weight (Monoisotopic): 363.1372AlogP: 5.93#Rotatable Bonds: 3Polar Surface Area: 53.70Molecular Species: NEUTRALHBA: 2HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.31CX Basic pKa: 3.58CX LogP: 4.94CX LogD: 4.94Aromatic Rings: 6Heavy Atoms: 28QED Weighted: 0.41Np Likeness Score: -0.08
References 1. Beato A, Gori A, Boucherle B, Peuchmaur M, Haudecoeur R.. (2021) β-Carboline as a Privileged Scaffold for Multitarget Strategies in Alzheimer's Disease Therapy., 64 (3.0): [PMID:33528252 ] [10.1021/acs.jmedchem.0c01887 ]