(S)-4-((2-amino-6-methyl-4-oxo-3,4-dihydroquinazolin-5-yl)thio)-N-(2-hydroxy-1-phenylethyl)benzamide

ID: ALA5289689

Max Phase: Preclinical

Molecular Formula: C24H22N4O3S

Molecular Weight: 446.53

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc2nc(N)[nH]c(=O)c2c1Sc1ccc(C(=O)N[C@H](CO)c2ccccc2)cc1

Standard InChI:  InChI=1S/C24H22N4O3S/c1-14-7-12-18-20(23(31)28-24(25)27-18)21(14)32-17-10-8-16(9-11-17)22(30)26-19(13-29)15-5-3-2-4-6-15/h2-12,19,29H,13H2,1H3,(H,26,30)(H3,25,27,28,31)/t19-/m1/s1

Standard InChI Key:  GMRUGTSMHKUHJN-LJQANCHMSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -0.3569    1.0207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0714    1.4332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7812    1.0215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7812    0.1966    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0668   -0.2159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0668   -1.0444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3504   -1.4526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3597   -1.0407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0742   -1.4532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0742   -2.2782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7886   -1.0407    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5031   -1.4532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5031   -2.2782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7797   -2.6735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2175   -1.0407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9350   -1.4550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6467   -1.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6467   -0.2177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9304    0.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2175   -0.2157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3597   -0.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3521    0.1963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4975    1.4295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2129    1.0171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2129    0.1921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9323    1.4311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9323    2.2552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6467    2.6678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2180    2.6735    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4975    2.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7831    2.6700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0714    2.2582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  1
 13 14  1  0
 12 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 15  2  0
  8 21  2  0
 21 22  1  0
 22  5  2  0
 23  3  2  0
 23 24  1  0
 24 25  2  0
 26 24  1  0
 27 26  1  0
 27 28  1  0
 29 27  2  0
 30 29  1  0
 30 23  1  0
 31 30  2  0
 32 31  1  0
  2 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5289689

    ---

Associated Targets(Human)

TYMS Tclin Thymidylate synthase (1651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.53Molecular Weight (Monoisotopic): 446.1413AlogP: 3.43#Rotatable Bonds: 6
Polar Surface Area: 121.10Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 11.23CX Basic pKa: 1.90CX LogP: 3.37CX LogD: 3.37
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -0.76

References

1. Alagarsamy V, Chitra K, Saravanan G, Solomon VR, Sulthana MT, Narendhar B..  (2018)  An overview of quinazolines: Pharmacological significance and recent developments.,  151  [PMID:29656203] [10.1016/j.ejmech.2018.03.076]

Source