The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Mycotrienol II ID: ALA5289776
Max Phase: Preclinical
Molecular Formula: C26H35NO6
Molecular Weight: 457.57
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@H]1/C=C/C=C/C=C/C[C@H](O)[C@H](C)[C@@H](O)/C(C)=C\CCc2cc(O)cc(c2O)NC(=O)C1
Standard InChI: InChI=1S/C26H35NO6/c1-17-10-9-11-19-14-20(28)15-22(26(19)32)27-24(30)16-21(33-3)12-7-5-4-6-8-13-23(29)18(2)25(17)31/h4-8,10,12,14-15,18,21,23,25,28-29,31-32H,9,11,13,16H2,1-3H3,(H,27,30)/b5-4+,8-6+,12-7+,17-10-/t18-,21-,23-,25-/m0/s1
Standard InChI Key: WXMPIECSLUKADI-OVININAMSA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
0.0027 1.2379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7173 1.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4294 1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4294 0.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7191 0.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0027 0.4093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7119 -0.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1440 0.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8586 0.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5734 0.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5734 -0.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8586 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8586 -2.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1440 -2.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4294 -2.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7147 -2.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7147 -2.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4294 -2.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1440 -2.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8588 -2.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8588 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1440 -0.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1440 0.0002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4294 -1.2374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5734 -2.4754 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2881 -2.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1440 -0.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2881 -1.2374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2881 0.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7173 2.4754 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5734 -2.4754 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7191 -0.8241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 3 1 0
5 4 2 0
1 6 2 0
6 5 1 0
6 7 1 0
7 8 1 0
9 8 1 0
10 9 2 0
11 10 1 0
12 11 1 0
13 12 1 0
14 13 1 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 1 0
23 22 1 0
4 24 1 0
24 23 1 0
23 25 2 0
21 26 1 1
26 27 1 0
12 28 1 1
11 29 1 1
10 30 1 0
2 31 1 0
13 32 1 6
5 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.57Molecular Weight (Monoisotopic): 457.2464AlogP: 3.75#Rotatable Bonds: 1Polar Surface Area: 119.25Molecular Species: NEUTRALHBA: 6HBD: 5#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.36CX Basic pKa: ┄CX LogP: 3.29CX LogD: 3.28Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.25Np Likeness Score: 1.87
References 1. Yang X, Wu W, Li H, Zhang M, Chu Z, Wang X, Sun P.. (2022) Natural occurrence, bioactivity, and biosynthesis of triene-ansamycins., 244 [PMID:36240545 ] [10.1016/j.ejmech.2022.114815 ]